| |
 |
Pumpellyite-(Fe+++) Mineral Data
|
|
|
General Pumpellyite-(Fe+++) Information
|
Chemical Formula: |
Ca2Fe+++Al2(SiO4)(Si2O7)(OH,O)2•(H2O) |
Composition: |
Molecular Weight = 502.25 gm |
| |
Calcium 15.96 % Ca 22.33 % CaO |
| |
Aluminum 10.74 % Al 20.30 % Al2O3 |
| |
Iron 11.12 % Fe 15.90 % Fe2O3 |
| |
Silicon 16.78 % Si 35.89 % SiO2 |
| |
Hydrogen 0.80 % H 7.17 % H2O |
| |
Oxygen 44.60 % O |
| |
______ ______ |
| |
100.00 % 101.59 % = TOTAL OXIDE |
Empirical Formula: |
Ca2Fe3+Al2(SiO4)(Si2O7)(OH)2•(H2O) |
Environment: |
Metamorphic rocks. |
IMA Status: |
Approved IMA 1973 |
Locality: |
Langban, near Filipstad, Varmland, Sweden (actually the TL of julgoldite). Link to MinDat.org Location Data. |
Name Origin: |
Named after the American geologist, R. Pumpelly (1837-1923). |
Name Pronunciation: |
Pumpellyite-(Fe+++) + Pronunciation |
| |