|
 |
Pumpellyite-(Fe++) Mineral Data
|
|
|
General Pumpellyite-(Fe++) Information
|
Chemical Formula: |
Ca2Fe++(Al,Fe+++)2(SiO4)(Si2O7)(OH)2•(H2O) |
Composition: |
Molecular Weight = 485.24 gm |
|
Calcium 16.52 % Ca 23.11 % CaO |
|
Aluminum 11.12 % Al 21.01 % Al2O3 |
|
Iron 11.51 % Fe 14.81 % FeO |
|
Silicon 17.36 % Si 37.15 % SiO2 |
|
Hydrogen 0.62 % H 5.57 % H2O |
|
Oxygen 42.86 % O |
|
______ ______ |
|
100.00 % 101.65 % = TOTAL OXIDE |
Empirical Formula: |
Ca2Fe2+Al2(SiO4)(Si2O7)(OH)•(H2O) |
IMA Status: |
Approved IMA 1971 |
Locality: |
Langban, near Filipstad, Varmland, Sweden (actually TL of julgoldite). Link to MinDat.org Location Data. |
Name Origin: |
Named after the American geologist, R. Pumpelly (1837-1923). |
Name Pronunciation: |
Pumpellyite-(Fe++) + Pronunciation |
Synonym: |
Ferropumpellyite |
|