| |
 |
Mukhinite Mineral Data
|
|
|
General Mukhinite Information
|
 Chemical Formula: |
Ca2Al2V+++(SiO4)3(OH) |
| Composition: |
Molecular Weight = 478.32 gm |
| |
Calcium 16.76 % Ca 23.45 % CaO |
| |
Aluminum 11.28 % Al 21.32 % Al2O3 |
| |
Vanadium 10.65 % V 15.67 % V2O3 |
| |
Silicon 17.62 % Si 37.68 % SiO2 |
| |
Hydrogen 0.21 % H 1.88 % H2O |
| |
Oxygen 43.48 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Ca2Al2V3+(SiO4)3(OH) |
| Environment: |
Metamorphic limestone with goldmanite, muscovite, and common sulphides. V analogue of clinozoisite. |
| IMA Status: |
Approved IMA 1969 - Dana number changed from 58.2.1a.10 |
| Locality: |
Tashelginsk iron deposit, Gornaya Shoriya, western Siberia, Russa. Link to MinDat.org Location Data. |
| Name Origin: |
Named for Alekseia Stepanovna Mukhin (1910-1973), Russian geologist, Western Siveria Geological Administration. |
| Name Pronunciation: |
Mukhinite + Pronunciation  |
| |
Mukhinite Crystallography
|
| Axial Ratios: |
a:b:c =1.5864:1:1.8092 |
| Cell Dimensions: |
a = 8.9, b = 5.61, c = 10.15, Z = 2; beta = 115.5° V = 457.41 Den(Calc)= 3.47 |
| Crystal System: |
Monoclinic - Prismatic H-M Symbol (2/m) Space Group: P 21/m |
| X Ray Diffraction: |
By Intensity(I/Io): 2.892(1), 2.6(0.8), 2.682(0.8), |
| |
Physical Properties of Mukhinite
|
| Cleavage: |
{001} Perfect, {100} Good |
| Color: |
Black. |
| Diaphaneity: |
Translucent |
| Fracture: |
Brittle - Generally displayed by glasses and most non-metallic minerals. |
| Hardness: |
8 - Topaz |
| Luster: |
Vitreous (Glassy) |
| Streak: |
brownish gray |
| |
Optical Properties of Mukhinite
|
| Gladstone-Dale: |
CI calc= 0.043 (Good) - where the CI = (1-KPDcalc/KC)
KPDcalc= 0.2124,KC= 0.2219
Ncalc = 1.77 |
| Optical Data: |
Biaxial (+), a=1.723, b=1.733, g=1.755, bire=0.0320, 2V(Calc)=70, 2V(Meas)=88. |
| Pleochroism (x): |
pale olive green. |
| Pleochroism (y): |
pale reddish brown. |
| Pleochroism (z): |
reddish brown. |
| |
Calculated Properties of Mukhinite
|
| Electron Density: |
Bulk Density (Electron Density)=3.42 gm/cc
note: Specific Gravity of Mukhinite =3.47 gm/cc.
|
| Fermion Index: |
Fermion Index = 0.0089278206
Boson Index = 0.9910721794 |
| Photoelectric: |
PEMukhinite = 5.06 barns/electron
U=PEMukhinite x rElectron Density= 17.34 barns/cc.
|
| Radioactivity: |
GRapi = 0 (Gamma Ray American Petroleum Institute Units)
Mukhinite is Not Radioactive |
| |
Mukhinite Classification
|
| Dana Class: |
58.02.01a.04 (58)Sorosilicate Insular, Mixed, Single, and Larger Tetrahedral Groups |
| |
(58.02)with cations in [6] and higher coordination; single and double groups (n=1,2) |
| |
(58.02.01a)Epidote group (Clinozoisite subgroup) |
| |
58.02.01a.01 Clinozoisite! Ca2Al3(SiO4)3(OH)=Ca2AlAl2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
58.02.01a.02 Epidote! Ca2(Fe,Al)3(SiO4)3(OH)=Ca2(Fe,Al)Al2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
58.02.01a.03 Epidote-(Pb)! (Ca,Pb,Sr)2(Al,Fe)3(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
58.02.01a.04 Mukhinite Ca2Al2V(SiO4)3(OH) P 21/m 2/m |
| |
58.02.01a.05 Piemontite Ca2(Al,Mn,Fe)3(SiO4)3(OH)=Ca2(Mn,Fe)Al2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
58.02.01a.06 Piemontite-(Sr)! (Ca,Mn)(Sr,Ca)Mn(Al,Mn,Fe)2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
58.02.01a.07 Manganipiemontite-(Sr)! CaSr(Mn,Fe)2Al[Si3O12](OH) P 21/m 2/m |
| |
58.02.01a.08 Gatelite-(Ce)! (Ca,Ce,La,Nd)4(Al,Mg,Fe)4[Si2O7][SiO4]3(O,F,OH)3 P 21/a 2/m |
| |
58.02.01a.09 Clinozoisite-(Sr)! CaSrAl3(Si2O7)(SiO4)O(OH) P 21/m 2/m |
| |
58.02.01a.10 Uedaite-(Ce)! MnCeAl2Fe(Si2O7)(SiO4)O(OH) P 21/m 2/m |
| |
58.02.01a.11 Epidote-(Sr)! CaSrAl2Fe(Si2O7)(SiO4)O(OH) P 21/m 2/m |
| Strunz Class: |
09.BG.05a 09 - SILICATES (Germanates) |
| |
09.B - Sorosilicates |
| |
09.BG -Sorosilicates with mixed SiO4 and Si2O7 groups; |
| |
09.BG.05a Clinozoisite Ca2Al3(SiO4)3(OH)=Ca2AlAl2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
09.BG.05a Epidote Ca2(Fe,Al)3(SiO4)3(OH)=Ca2(Fe,Al)Al2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
09.BG.05a Epidote-(Pb) (Ca,Pb,Sr)2(Al,Fe)3(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
09.BG.05a Mukhinite Ca2Al2V(SiO4)3(OH) P 21/m 2/m |
| |
09.BG.05a Piemontite Ca2(Al,Mn,Fe)3(SiO4)3(OH)=Ca2(Mn,Fe)Al2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
09.BG.05a Piemontite-(Sr)! (Ca,Mn)(Sr,Ca)Mn(Al,Mn,Fe)2(SiO4)(Si2O7)O(OH) P 21/m 2/m |
| |
09.BG.05a Manganipiemontite-(Sr)! CaSr(Mn,Fe)2Al[Si3O12](OH) P 21/m 2/m |
| |
09.BG.05a Clinozoisite-(Sr)! CaSrAl3(Si2O7)(SiO4)O(OH) P 21/m 2/m |
| |
09.BG.05a Epidote-(Sr)! CaSrAl2Fe(Si2O7)(SiO4)O(OH) P 21/m 2/m |
| |
Other Mukhinite Information
|
| References: |
NAME( Dana8) PHYS. PROP.(Enc. of Minerals,2nd ed.,1990) OPTIC PROP.(Dana8) |
| See Also: |
Links to other databases for Mukhinite :
1 - Am. Min. Crystal Structure Database
2 - Athena
3 - EUROmin Project
4 - Ecole des Mines de Paris
5 - GeoScienceWorld
6 - Google Images
7 - Google Scholar
8 - Handbook of Mineralogy (MinSocAm)
9 - Handbook of Mineralogy (UofA)
10 - MinDAT
11 - Mineralienatlas (Deutsch)
12 - Online Mineral Museum
13 - QUT Mineral Atlas
14 - Ruff.Info
Search for Mukhinite using:
[AOL]
[Bing]
[Dog Pile]
[GeoScienceWorld]
[HotBot]
[Ixquick]
[Lycos]
[MAMMA]
[Scirus]
[Teoma]
[WebCrawler]
[Wikipedia]
[YAHOO]
Visit our Advertisers for Mukhinite :
Ask about Mukhinite here :
Ask-A-Mineralogist from the Mineralogical Society of America
Mindat.org's Discussion Groups
Original Rockhounds Discussion Group
Rockhounds Discussion Group on Yahoo Groups
Mineral Discussion Forum from Fabre Minerals - also available in
Espaņol
Print or Cut-and-Paste your Mukhinite Specimen Label here :
|
Mukhinite
Ca2Al2V+++(SiO4)3(OH)
Dana No: 58.02.01a.04 Strunz No: 09.BG.05a
Locality:
Notes:
|
|
| |
| |
|
| |
Dakota Matrix
Excalibur Minerals
Exceptional Minerals
Hudson Insitute
John Betts Fine Minerals
Mc Dougall Minerals
Mineral News
Rock and Mineral Shows
Weinrich Minerals, Inc.