 |
X-Ray Diffraction Table |
|
|
X-Ray Diffraction Table |
See Help on X-Ray Diffraction.
Powder X-ray Diffraction (XRD) is one of the primary techniques used by mineralogists and solid state chemists to examine the physico-chemical make-up of unknown materials. This data is represented in a collection of single-phase X-ray powder diffraction patterns for the three most intense D values in the form of tables of interplanar spacings (D), relative intensities (I/Io), mineral name and chemical formulae
The XRD technique takes a sample of the material and places a powdered sample in a holder, then the sample is illuminated with x-rays of a fixed wave-length and the intensity of the reflected radiation is recorded using a goniometer. This data is then analyzed for the reflection angle to calculate the inter-atomic spacing (D value in Angstrom units - 10-8 cm). The intensity(I) is measured to discriminate (using I ratios) the various D spacings and the results are compared to this table to identify possible matches. Note: 2 theta (Θ) angle calculated from the Bragg Equation, 2 Θ = 2(arcsin(n λ/(2d)) where n=1
For more information about this technique, see X-Ray Analysis of a Solid or take an internet course at Birkbeck College On-line Courses. Many thanks to Frederic Biret for these data.
| D1 Å (2θ) |
I1 %) |
D2 Å (2θ) |
I2 (%) |
D3 Å (2θ) |
I3 (%) |
Mineral | Formula |
| 5.826(15.20) | 200 | 7.078(12.50) | 200 | 7.534(11.74) | 180 | Neustadtelite | Bi2Fe+++(Fe+++,Co)(O,OH)2(OH)2(AsO4)2 |
| 5.828(15.19) | 200 | 5.294(16.73) | 116 | 3.464(25.70) | 92 | Aluminocerite-(Ce) | (Ce,REE,Ca)9(Al,Fe+++)(SiO4)3[SiO3(OH)]4(OH)3 |
| 5.830(15.18) | 200 | 5.586(15.85) | 180 | 4.034(22.02) | 148 | Tin | Sn |
| 5.830(15.18) | 200 | 5.418(16.35) | 140 | 5.704(15.52) | 60 | Dollaseite-(Ce) | CaCeMg2AlSi3O11(OH,F)2 |
| 5.830(15.18) | 200 | 9.400(9.40) | 108 | 8.420(10.50) | 80 | Frankamenite | K3Na3Ca5(Si12O30)[F,(OH)]4·(H2O) |
| 5.830(15.18) | 200 | 3.790(23.45) | 150 | 5.512(16.07) | 122 | Takedaite | Ca3(BO3)2 |
| 5.830(15.18) | 200 | 8.408(10.51) | 80 | 11.744(7.52) | 62 | Fluorcanasite | K3Na3Ca5Si12O30F4·H2O |
| 5.830(15.18) | 200 | 8.920(9.91) | 180 | 5.276(16.79) | 160 | Mckelveyite-(Y) | NaCa(Ba,Sr)3(Y,REE)(CO3)6·3(H2O) |
| 5.832(15.18) | 200 | 5.872(15.08) | 100 | 6.986(12.66) | 100 | Piemontite-(Sr) | (Ca,Mn++)(Sr,Ca)Mn+++(Al,Mn+++,Fe+++)2(SiO4)(Si2O7)O(OH) |
| 5.832(15.18) | 200 | 24.820(3.56) | 160 | 6.000(14.75) | 148 | Cetineite | (K,Na)3+x(Sb2O3)3(Sb2S3)(OH)x·(2.8-x)(H2O) |
| 5.832(15.18) | 154 | 7.478(11.82) | 82 | 7.222(12.25) | 46 | Krasnoselskite | CoWO4 |
| 5.834(15.17) | 200 | 5.912(14.97) | 160 | 8.126(10.88) | 140 | Novgorodovaite | Ca2(C2O4)Cl2·2(H2O) |
| 5.836(15.17) | 200 | 5.920(14.95) | 170 | 6.820(12.97) | 170 | Sorensenite | Na4SnBe2Si6O18·2(H2O) |
| 5.838(15.16) | 200 | 5.318(16.66) | 162 | 12.564(7.03) | 138 | IMA2008-032 | CuCl2·2NH3 |
| 5.838(15.16) | 200 | 10.074(8.77) | 180 | 11.240(7.86) | 180 | Duranusite | As4S |
| 5.840(15.16) | 200 | 7.020(12.60) | 200 | 7.440(11.89) | 200 | Neyite | AgCu3Pb12.5Bi13S34 |
| 5.840(15.16) | 200 | 7.080(12.49) | 180 | 16.840(5.24) | 160 | Melkovite | CaFe+++H6(MoO4)4(PO4)·6(H2O) |
| 5.840(15.16) | 200 | 7.060(12.53) | 108 | 5.420(16.34) | 86 | Uedaite-(Ce) | Mn++CeAl2Fe++(Si2O7)(SiO4)O(OH) |
| 5.840(15.16) | 200 | 4.020(22.09) | 140 | 4.260(20.83) | 120 | Stibarsen | SbAs |
| 5.840(15.16) | 200 | 3.584(24.82) | 180 | 3.068(29.08) | 160 | Hiarneite | (Ca,Mn,Na)2(Zr,Mn+++)5(Sb,Ti,Fe)2O16 |
| 5.840(15.16) | 200 | 4.200(21.14) | 120 | 6.140(14.41) | 60 | Merenskyite | (Pd,Pt)(Te,Bi)2 |
| 5.840(15.16) | 200 | 3.032(29.43) | 70 | 3.442(25.86) | 60 | Srilankite | (Ti,Zr)O2 |
| 5.840(15.16) | 200 | 7.400(11.95) | 160 | 3.364(26.47) | 130 | Kyzylkumite | V+++2Ti3O9 |
| 5.840(15.16) | 200 | 11.860(7.45) | 160 | 8.880(9.95) | 120 | Gonnardite | Na2CaAl4Si6O20·7(H2O) |
| 5.840(15.16) | 200 | 4.180(21.24) | 180 | 7.180(12.32) | 180 | Hydroxylbastnasite-(Ce) | Ce(CO3)(OH) |
| 5.840(15.16) | 200 | 5.680(15.59) | 180 | 6.440(13.74) | 180 | Kurgantaite | CaSr[B5O9]Cl·(H2O) |
| 5.840(15.16) | 200 | 6.120(14.46) | 160 | 8.420(10.50) | 120 | Kasolite | Pb(UO2)SiO4·(H2O) |
| 5.840(15.16) | 200 | 5.428(16.32) | 130 | 7.060(12.53) | 90 | Allanite-(Ce) | (Ce,Ca,Y)2(Al,Fe+++)3(SiO4)3(OH) |
| 5.840(15.16) | 200 | 8.760(10.09) | 180 | 6.880(12.86) | 110 | Tincalconite | Na6[B4O5(OH)4]3·8(H2O) |
| 5.840(15.16) | 200 | 6.600(13.40) | 100 | 4.460(19.89) | 100 | Biraite-(Ce) | Ce2Fe++(CO3)(Si2O7) |
| 5.840(15.16) | 200 | 5.960(14.85) | 200 | 6.980(12.67) | 200 | Tvalchrelidzeite | Hg3SbAsS3 |
| 5.840(15.16) | 200 | 3.480(25.58) | 120 | 6.920(12.78) | 100 | Viseite | Ca10Al24(SiO4)6(PO4)7O22F3·72(H2O) (?) |
| 5.840(15.16) | 200 | 18.760(4.71) | 160 | 3.394(26.24) | 140 | Chabazite-Sr | (Sr,Ca,K2,Na2)[Al2Si4O12]·6(H2O) |
| 5.840(15.16) | 200 | 6.660(13.28) | 180 | 9.520(9.28) | 180 | Hillebrandite | Ca6Si3O9(OH)6 |
| 5.840(15.16) | 200 | 13.420(6.58) | 200 | 9.400(9.40) | 160 | Natroboltwoodite | (H3O)(Na,K)(UO2)SiO4·(H2O) |
| 5.840(15.16) | 200 | 6.760(13.09) | 200 | 6.040(14.65) | 160 | Barylite | BaBe2Si2O7 |
| 5.842(15.15) | 200 | 7.362(12.01) | 200 | 4.806(18.45) | 180 | Eyselite | Fe+++Ge++++3O7(OH) |
| 5.842(15.15) | 200 | 5.586(15.85) | 180 | 8.410(10.51) | 150 | Spodumene | LiAlSi2O6 |
| 5.842(15.15) | 200 | 5.160(17.17) | 98 | 5.228(16.95) | 84 | Epidote-(Sr) | CaSrAl2Fe+++(Si2O7)(SiO4)O(OH) |
| 5.844(15.15) | 200 | 7.144(12.38) | 120 | 9.060(9.75) | 74 | Sweetite | Zn(OH)2 |
| 5.846(15.14) | 200 | 6.138(14.42) | 150 | 5.600(15.81) | 110 | Hydrodelhayelite | KCa2AlSi7O17(OH)2·6(H2O) |
| 5.848(15.14) | 200 | 5.330(16.62) | 180 | 5.444(16.27) | 180 | Hemloite | (As,Sb)2(Ti,V,Fe,Al)12O23OH |
| 5.848(15.14) | 200 | 8.200(10.78) | 200 | 14.500(6.09) | 140 | Petarasite | Na5Zr2Si6O18(Cl,OH)·2(H2O) |
| 5.850(15.13) | 200 | 6.302(14.04) | 200 | 9.280(9.52) | 200 | Amblygonite | (Li,Na)Al(PO4)(F,OH) |
| 5.850(15.13) | 200 | 8.640(10.23) | 150 | 18.700(4.72) | 100 | Chabazite-Ca | (Ca0.5,Na,K)4[Al4Si8O24]·12H2O |
| 5.852(15.13) | 200 | 4.072(21.81) | 160 | 4.202(21.13) | 160 | Bohdanowiczite | AgBiSe2 |
| 5.852(15.13) | 200 | 5.720(15.48) | 106 | 5.106(17.35) | 102 | Dissakisite-(La) | (Ca,Fe++,Th, La)(La,REE,Ca)(Al,Cr,Ti)2(Mg,Fe,Al)Si3O12(OH,F) with La > Ce |
| 5.852(15.13) | 200 | 3.400(26.19) | 120 | 4.934(17.96) | 100 | Sanmartinite | (Zn,Fe++)WO4 |
| 5.852(15.13) | 200 | 7.556(11.70) | 180 | 3.284(27.13) | 100 | Pinalite | Pb3(WO4)OCl2 |
| 5.854(15.12) | 200 | 6.870(12.88) | 88 | 5.930(14.93) | 72 | Dixenite | Cu+Mn++14Fe+++(As+++O3)5(SiO4)2(As+++++O4)(OH)6 |
| 5.858(15.11) | 100 | 3.198(27.87) | 50 | 3.970(22.38) | 50 | Zincospiroffite | Zn2Te3O8 |
| 5.858(15.11) | 200 | 5.252(16.87) | 182 | 3.372(26.41) | 84 | IMA2007-058 | TiO2 |
| 5.858(15.11) | 200 | 5.952(14.87) | 200 | 7.146(12.38) | 180 | Watkinsonite | PbCu2Bi4(Se,S)8 |
| 5.860(15.11) | 200 | 4.360(20.35) | 100 | 25.040(3.53) | 100 | Steigerite | AlVO4·3(H2O) |
| 5.860(15.11) | 200 | 6.000(14.75) | 180 | 3.150(28.31) | 140 | Aeschynite-(Nd) | (Nd,Ce)(Ti,Nb)2(O,OH)6 |
| 5.860(15.11) | 200 | 6.180(14.32) | 180 | 6.360(13.91) | 160 | Wolfeite | (Fe++,Mn++)2(PO4)(OH) |
| 5.860(15.11) | 200 | 8.640(10.23) | 130 | 12.720(6.94) | 100 | Herschelite | (Na,Ca,K)AlSi2O6·3(H2O) |
| 5.860(15.11) | 200 | 3.320(26.83) | 160 | 7.760(11.39) | 160 | Blixite | Pb8O5(OH)2Cl4 |
| 5.860(15.11) | 200 | 11.340(7.79) | 180 | 4.342(20.44) | 160 | Florencite-(La) | (La,Ce)Al3(PO4)2(OH)6 |
| 5.860(15.11) | 200 | 6.580(13.45) | 120 | 2.000(45.30) | 100 | Daomanite | CuPtAsS2 |
| 5.860(15.11) | 200 | 7.634(11.58) | 140 | 5.096(17.39) | 130 | Poppiite | Ca2(V+++,Fe+++,Mg)(V+++,Al)2(Si,Al)3(O,OH)14 |
| 5.860(15.11) | 200 | 5.940(14.90) | 180 | 3.652(24.35) | 180 | Fedorite | KNa4Ca4(Al,Si)16O36(OH,F)4·6(H2O) |
| 5.860(15.11) | 200 | 7.570(11.68) | 100 | 5.650(15.67) | 80 | Mereheadite | Pb2O(OH)Cl |
| 5.860(15.11) | 200 | 11.320(7.80) | 142 | 6.966(12.70) | 100 | Waylandite | BiAl3(PO4)2(OH)6 |
| 5.860(15.11) | 200 | 4.220(21.03) | 160 | 4.040(21.98) | 140 | Moncheite | (Pt,Pd)(Te,Bi)2 |
| 5.860(15.11) | 200 | 4.420(20.07) | 160 | 9.600(9.20) | 160 | Kafehydrocyanite | K4Fe++(CN)6·3(H2O) |
| 5.860(15.11) | 200 | 5.640(15.70) | 80 | 5.014(17.67) | 60 | Zirconolite-2M | CaZrTi2O7 |
| 5.860(15.11) | 200 | 13.130(6.73) | 310 | 9.500(9.30) | 130 | Pumpellyite-(Mn++) | Ca2(Mn++,Mg)(Al,Mn+++,Fe)2(SiO4)(Si2O7(OH)2·(H2O) |
| 5.862(15.10) | 200 | 4.064(21.85) | 170 | 13.100(6.74) | 132 | Lingunite | (Na,Ca)AlSi3O8 |
| 5.862(15.10) | 200 | 8.120(10.89) | 140 | 14.740(5.99) | 120 | Loudounite | NaCa5Zr4Si16O40(OH)11·8(H2O) |
| 5.864(15.10) | 200 | 11.728(7.53) | 178 | 6.099(14.51) | 174 | Alacranite | As8S9 |
| 5.866(15.09) | 200 | 5.118(17.31) | 170 | 7.924(11.16) | 110 | Liddicoatite | Ca(Li,Al)3Al6(BO3)3Si6O18(O,OH,F)4 |
| 5.866(15.09) | 200 | 8.980(9.84) | 180 | 5.310(16.68) | 160 | Mckelveyite-(Nd) | (Ba,Sr)(Ca,Na,Nd,REE)(CO3)2·3-10(H2O) |
| 5.866(15.09) | 200 | 5.478(16.17) | 150 | 9.100(9.71) | 140 | Arsenoclasite | Mn5(AsO4)2(OH)4 |
| 5.868(15.09) | 200 | 5.348(16.56) | 120 | 6.180(14.32) | 90 | Pyroxferroite | (Fe++,Mn)7[Si7O21] |
| 5.872(15.08) | 200 | 6.186(14.31) | 200 | 17.364(5.09) | 200 | Barringtonite | MgCO3·2(H2O) |
| 5.872(15.08) | 200 | 25.400(3.48) | 140 | 5.216(16.98) | 70 | Benleonardite | Ag8(Sb,As)Te2S3 |
| 5.872(15.08) | 200 | 4.364(20.33) | 160 | 5.172(17.13) | 160 | Manganipiemontite-(Sr) | CaSr(Mn+++,Fe+++)2Al[Si3O12](OH) |
| 5.874(15.07) | 200 | 5.404(16.39) | 180 | 5.318(16.66) | 160 | Polyphite-VII | Na17Ca3Mg(Ti,Mn)4[Si2O7]2(PO4)6O2F6 |
| 5.874(15.07) | 200 | 5.404(16.39) | 180 | 5.318(16.66) | 160 | Polyphite-VIII | Na17Ca3Mg(Ti,Mn)4[Si2O7]2(PO4)6O2F6 |
| 5.874(15.07) | 200 | 7.776(11.37) | 102 | 15.620(5.65) | 70 | Belkovite | Ba3(Nb,Ti)6(Si2O7)2O12 |
| 5.874(15.07) | 200 | 6.390(13.85) | 130 | 6.738(13.13) | 120 | Topaz | Al2SiO4(F,OH)2 |
| 5.876(15.07) | 200 | 6.350(13.93) | 200 | 6.796(13.02) | 200 | Ferrilotharmeyerite | Ca(Zn,Cu++)(Fe+++,Zn)(AsO4)2(OH,H2O)2 |
| 5.876(15.07) | 200 | 5.996(14.76) | 200 | 6.200(14.27) | 200 | Manganbabingtonite | Ca2(Mn,Fe++)Fe+++Si5O14(OH) |
| 5.880(15.05) | 200 | 6.214(14.24) | 180 | 6.442(13.73) | 140 | Triploidite | (Mn,Fe++)2(PO4)(OH) |
| 5.880(15.05) | 200 | 11.840(7.46) | 120 | 8.880(9.95) | 80 | Paranatrolite | Na2[Al2Si3O10]·3(H2O) |
| 5.880(15.05) | 200 | 3.628(24.52) | 60 | 3.674(24.20) | 50 | Kutnohorite | Ca(Mn,Mg,Fe++)(CO3)2 |
| 5.880(15.05) | 200 | 3.940(22.55) | 112 | 10.080(8.77) | 106 | Paratooite-(La) | REE3(Ca,Sr)2NaCu(CO3)8 |
| 5.880(15.05) | 200 | 3.780(23.52) | 188 | 4.380(20.26) | 172 | Woodhouseite | CaAl3(PO4)(SO4)(OH)6 |
| 5.880(15.05) | 200 | 3.966(22.40) | 180 | 5.360(16.53) | 160 | Testibiopalladite | PdTe(Sb,Te) |
| 5.880(15.05) | 200 | 3.602(24.70) | 160 | 3.070(29.06) | 100 | Tennantite | (Cu,Fe)12As4S13 |
| 5.880(15.05) | 200 | 6.000(14.75) | 200 | 3.162(28.20) | 140 | Tantalaeschynite-(Y) | (Y,Ce,Ca)(Ta,Ti,Nb)2O6 |
| 5.880(15.05) | 200 | 13.200(6.69) | 160 | 9.340(9.46) | 140 | Mountainite | (Ca,Na2,K2)2Si4O10·3(H2O) |
| 5.880(15.05) | 200 | 6.000(14.75) | 180 | 6.200(14.27) | 160 | Roeblingite | Pb2Ca6(Si6O18)(SO4)2(OH)2·4(H2O) |
| 5.880(15.05) | 200 | 6.120(14.46) | 160 | 3.780(23.52) | 120 | Rosenbuschite | (Ca,Na)3(Zr,Ti)Si2O8F |
| 5.880(15.05) | 200 | 6.740(13.12) | 100 | 2.944(30.34) | 100 | Crerarite | (Pt,Pb)Bi3(S,Se)4-x (x~0.7) |
| 5.880(15.05) | 200 | 4.956(17.88) | 96 | 5.726(15.46) | 90 | Kushiroite | CaAl2SiO6 |
| 5.880(15.05) | 200 | 3.662(24.29) | 100 | 4.018(22.10) | 100 | IMA2008-009 | Sr5(PO4)3F |
| 5.880(15.05) | 200 | 8.860(9.98) | 180 | 5.780(15.32) | 160 | Orthojoaquinite-(Ce) | NaFe++Ba2Ce2Ti2[Si4O12]2 O2(OH)·(H2O) |
| 5.880(15.05) | 200 | 6.580(13.45) | 200 | 3.300(27.00) | 160 | Bazzite | Be3(Sc,Al)2Si6O18 |