| |
 |
Roeblingite Mineral Data
|
|
|
General Roeblingite Information
|
Chemical Formula: |
Pb2Ca6(Si6O18)(SO4)2(OH)2•4(H2O) |
Composition: |
Molecular Weight = 1,409.57 gm |
| |
Calcium 17.06 % Ca 23.87 % CaO |
| |
Silicon 11.95 % Si 25.58 % SiO2 |
| |
Hydrogen 0.72 % H 6.39 % H2O |
| |
Lead 29.40 % Pb 31.67 % PbO |
| |
Sulfur 4.55 % S 11.36 % SO3 |
| |
Oxygen 36.32 % O |
| |
______ ______ |
| |
100.00 % 98.86 % = TOTAL OXIDE |
Empirical Formula: |
Pb2Ca6Si6O18(SO4)2(OH)2•4(H2O) |
IMA Status: |
Valid Species (Pre-IMA) 1897 |
Locality: |
Franklin, Sussex Co., New Jersey, USA. Link to MinDat.org Location Data. |
Name Origin: |
Named after Washington A. Roebling (1837-1926), well known mineral collector and builder of the Brooklyn Bridge. |
Name Pronunciation: |
Roeblingite + Pronunciation |
Synonym: |
ICSD 40097 |
| |
PDF 16-411 |
| |