![]() |
X-Ray Diffraction Table |
See Help on X-Ray Diffraction.
Powder X-ray Diffraction (XRD) is one of the primary techniques used by mineralogists and solid state chemists to examine the physico-chemical make-up of unknown materials. This data is represented in a collection of single-phase X-ray powder diffraction patterns for the three most intense D values in the form of tables of interplanar spacings (D), relative intensities (I/Io), mineral name and chemical formulae
The XRD technique takes a sample of the material and places a powdered sample in a holder, then the sample is illuminated with x-rays of a fixed wave-length and the intensity of the reflected radiation is recorded using a goniometer. This data is then analyzed for the reflection angle to calculate the inter-atomic spacing (D value in Angstrom units - 10-8 cm). The intensity(I) is measured to discriminate (using I ratios) the various D spacings and the results are compared to this table to identify possible matches. Note: 2 theta (Θ) angle calculated from the Bragg Equation, 2 Θ = 2(arcsin(n λ/(2d)) where n=1
For more information about this technique, see X-Ray Analysis of a Solid or take an internet course at Birkbeck College On-line Courses. Many thanks to Frederic Biret for these data.
| D1 Å (2θ) |
I1 %) |
D2 Å (2θ) |
I2 (%) |
D3 Å (2θ) |
I3 (%) |
Mineral | Formula |
| 5.354(16.54) | 200 | 5.386(16.44) | 150 | 6.896(12.83) | 130 | Ferrorosemaryite | [ ]NaFe++Fe+++Al(PO4)3 |
| 5.360(16.53) | 200 | 6.620(13.36) | 170 | 8.520(10.37) | 170 | Itoigawaite | SrAl2Si2O7(OH)2·(H2O) |
| 5.360(16.53) | 200 | 9.520(9.28) | 162 | 5.312(16.68) | 100 | Reppiaite | Mn++5[(V,As)O4]2(OH)4 |
| 5.360(16.53) | 200 | 5.800(15.26) | 200 | 5.380(16.46) | 140 | Epidote | Ca2(Fe+++,Al)3(SiO4)3(OH) = Ca2(Fe,Al)Al2(SiO4)(Si2O7)O(OH) |
| 5.360(16.53) | 200 | 4.160(21.34) | 80 | 11.800(7.49) | 64 | Molysite | Fe+++Cl3 |
| 5.360(16.53) | 200 | 8.360(10.57) | 180 | 4.940(17.94) | 160 | Ferrotychite | Na6Fe++2(SO4)(CO3)4 |
| 5.362(16.52) | 200 | 5.692(15.56) | 160 | 3.165(28.17) | 100 | Graeserite | (Fe+++,Ti)4Ti3AsO13(OH) |
| 5.368(16.50) | 200 | 5.998(14.76) | 140 | 3.206(27.80) | 120 | Uvarovite | Ca3Cr2(SiO4)3 |
| 5.370(16.49) | 200 | 6.944(12.74) | 180 | 5.024(17.64) | 180 | Qingheiite | Na2(Mn++,Mg,Fe++)(Al,Fe+++)(PO4)3 |
| 5.372(16.49) | 200 | 6.006(14.74) | 84 | 4.904(18.07) | 78 | Wadalite | Ca6Al5Si2O16Cl3 |
| 5.372(16.49) | 200 | 5.186(17.08) | 150 | 6.840(12.93) | 120 | Hagendorfite | NaCaMn(Fe++,Fe+++,Mg)2(PO4)3 |
| 5.373(16.48) | 200 | 5.342(16.58) | 130 | 5.306(16.69) | 94 | Merwinite | Ca3Mg(SiO4)2 |
| 5.374(16.48) | 200 | 6.754(13.10) | 160 | 8.870(9.96) | 160 | IMA2009-012 | NaNa2(Mg2Al2Li)Si8O22F2 |
| 5.374(16.48) | 200 | 21.300(4.14) | 120 | 6.158(14.37) | 110 | Nyboite | NaNa2(Mg3Al2)Si7AlO22(OH)2 |
| 5.376(16.48) | 200 | 5.992(14.77) | 138 | 5.926(14.94) | 96 | Schlegelite | Bi7O4(MoO4)2(AsO4)3 |
| 5.376(16.48) | 200 | 6.010(14.73) | 130 | 3.214(27.73) | 98 | Goldmanite | Ca3(V,Al,Fe+++)2(SiO4)3 |
| 5.380(16.46) | 200 | 6.020(14.70) | 140 | 3.220(27.68) | 100 | Yamatoite | (Mn++,Ca)3(V+++,Al)2(SiO4)3 |
| 5.380(16.46) | 200 | 6.076(14.57) | 80 | 6.260(14.14) | 74 | Hillite | Ca2(Zn, Mg)[PO4]2·2(H2O) |
| 5.380(16.46) | 200 | 3.380(26.35) | 120 | 5.020(17.65) | 100 | Hematite | Fe2O3 |
| 5.380(16.46) | 200 | 5.740(15.42) | 130 | 8.060(10.97) | 100 | Zoisite | Ca2Al3(SiO4)3(OH) = Ca2AlAl2(SiO4)(Si2O7)O(OH) |
| 5.382(16.46) | 200 | 5.720(15.48) | 200 | 5.920(14.95) | 200 | Thomsonite-Sr | (Sr,Ca)2Na[Al5Si5O20]·7(H2O) |
| 5.382(16.46) | 200 | 16.614(5.31) | 128 | 6.158(14.37) | 116 | Fluoronyboite | NaNa2(Al2Mg3)(Si7Al)O22(F,OH)2 |
| 5.384(16.45) | 200 | 5.580(15.87) | 110 | 4.480(19.80) | 90 | Carbonate-fluorapatite | Ca5(PO4,CO3)3F |
| 5.386(16.44) | 200 | 6.024(14.69) | 200 | 4.744(18.69) | 160 | Staurolite | (Fe++,Mg)2Al9(Si,Al)4O20(O,OH)4 |
| 5.386(16.44) | 200 | 6.220(14.23) | 160 | 16.760(5.27) | 130 | Kaersutite | NaCa2(Mg4Ti)Si6Al2O23(OH)2 |
| 5.388(16.44) | 200 | 24.000(3.68) | 200 | 5.196(17.05) | 110 | Eggletonite | Na2Mn8[Si11AlO29](OH)7·11(H2O) |
| 5.390(16.43) | 200 | 5.576(15.88) | 100 | 5.634(15.72) | 100 | Harstigite | Ca6MnBe4(SiO4)2(Si2O7)2(OH)2 |
| 5.390(16.43) | 200 | 8.440(10.47) | 152 | 4.948(17.91) | 140 | Manganotychite | Na6(Mn++,Fe++,Mg)2(SO4)(CO3)4 |
| 5.392(16.43) | 200 | 3.222(27.66) | 120 | 6.030(14.68) | 120 | Andradite | Ca3Fe+++2(SiO4)3 |
| 5.394(16.42) | 200 | 4.030(22.04) | 180 | 5.800(15.26) | 160 | Teepleite | Na2B(OH)4Cl |
| 5.394(16.42) | 200 | 5.084(17.43) | 180 | 6.254(14.15) | 160 | Dellaventuraite | NaNa2(Mg2,Mn+++,Li,Ti)Si8O22O2 |
| 5.394(16.42) | 200 | 16.762(5.27) | 184 | 6.208(14.26) | 138 | Alumino-magnesiotaramite | Na(CaNa)(Mg3Al2)(Si6Al2)O22(OH)2 |
| 5.396(16.41) | 200 | 5.820(15.21) | 180 | 5.244(16.89) | 120 | Dissakisite-(Ce) | Ca(Ce,REE)(Mg,Fe++)(Al,Fe+++)2Si3O12(OH) |
| 5.398(16.41) | 200 | 4.441(19.98) | 68 | 6.655(13.29) | 60 | Empressite | AgTe |
| 5.400(16.40) | 200 | 4.030(22.04) | 160 | 3.612(24.63) | 120 | Sederholmite | NiSe |
| 5.400(16.40) | 200 | 5.660(15.64) | 200 | 6.120(14.46) | 200 | Saneroite | Na2(Mn++,Fe+++)10Si11V+++++O34(OH)4 |
| 5.400(16.40) | 200 | 5.060(17.51) | 180 | 16.800(5.26) | 180 | Winchite | [ ](CaNa)Mg4(Al,Fe3+)Si8O22(OH)2 |
| 5.400(16.40) | 200 | 3.820(23.27) | 100 | 5.440(16.28) | 80 | Perovskite | CaTiO3 |
| 5.400(16.40) | 200 | 11.500(7.68) | 200 | 4.890(18.13) | 180 | Claringbullite | Cu++4(OH)7Cl |
| 5.400(16.40) | 200 | 6.060(14.61) | 190 | 5.340(16.59) | 158 | Cassidyite | Ca2(Ni,Mg)(PO4)2·2(H2O) |
| 5.400(16.40) | 200 | 16.680(5.29) | 164 | 6.188(14.30) | 134 | Fluoro-alumino-magnesiotaramite | Na(CaNa)(Mg3Al2)(Si6Al2)O22F2 |
| 5.400(16.40) | 200 | 10.600(8.33) | 200 | 8.160(10.83) | 110 | Kermesite | Sb2S2O |
| 5.402(16.40) | 200 | 16.688(5.29) | 196 | 6.784(13.04) | 148 | Ferriwhittakerite | Na(NaLi)(Mg2Fe+++2Li)Si8O22(OH)2 |
| 5.402(16.40) | 200 | 5.292(16.74) | 130 | 5.334(16.61) | 120 | Spurrite | Ca5(SiO4)2(CO3) |
| 5.404(16.39) | 200 | 3.774(23.55) | 160 | 6.300(14.05) | 160 | Trechmannite | AgAsS2 |
| 5.404(16.39) | 200 | 3.301(26.99) | 60 | 4.700(18.87) | 30 | Abswurmbachite | Cu++Mn+++6SiO12 |
| 5.406(16.38) | 200 | 12.480(7.08) | 140 | 6.170(14.34) | 110 | Ferroalluaudite | NaCaFe++(Fe++,Mn,Fe+++,Mg)2(PO4)3 |
| 5.406(16.38) | 200 | 5.751(15.39) | 180 | 5.579(15.87) | 160 | Heneuite | CaMg5(PO4)3(CO3)(OH) |
| 5.408(16.38) | 200 | 8.786(10.06) | 180 | 10.120(8.73) | 180 | Orientite | Ca2Mn++Mn+++2Si3O10(OH)4 |
| 5.412(16.37) | 200 | 4.892(18.12) | 160 | 16.220(5.44) | 140 | Lesukite | Al2(OH)5Cl·2(H2O) |
| 5.416(16.35) | 200 | 6.246(14.17) | 150 | 6.772(13.06) | 134 | Parvo-mangano-edenite | Na(CaMn)2Mg5(Si7Al)O22(OH)2 |
| 5.418(16.35) | 200 | 10.100(8.75) | 160 | 3.378(26.36) | 140 | Natisite | Na2(TiO)SiO4 |
| 5.418(16.35) | 200 | 5.678(15.59) | 170 | 14.560(6.07) | 140 | Ilvaite | CaFe++2Fe+++Si2O7O(OH) |
| 5.418(16.35) | 200 | 3.516(25.31) | 160 | 4.838(18.32) | 160 | Viaeneite | (Fe,Pb)4S8O |
| 5.420(16.34) | 200 | 5.520(16.04) | 200 | 7.800(11.33) | 120 | Hematophanite | Pb4Fe+++3O8(OH,Cl) |
| 5.420(16.34) | 200 | 6.280(14.09) | 200 | 6.340(13.96) | 200 | Chevkinite-(Ce) | (Ce,La,Ca,Th)4(Fe++,Mg)2(Ti,Fe+++)3Si4O22 |
| 5.420(16.34) | 200 | 3.520(25.28) | 126 | 6.880(12.86) | 80 | Marcasite | FeS2 |
| 5.420(16.34) | 200 | 6.380(13.87) | 140 | 8.500(10.40) | 140 | Gismondine | Ca2Al4Si4O16·9(H2O) |
| 5.420(16.34) | 200 | 6.180(14.32) | 160 | 15.820(5.58) | 140 | Scheuchzerite | Na(Mn,Mg)9[VSi9O28(OH)](OH)3 |
| 5.420(16.34) | 200 | 6.020(14.70) | 180 | 8.260(10.70) | 160 | Galileiite | NaFe++4(PO4)3 |
| 5.420(16.34) | 200 | 3.900(22.78) | 190 | 5.920(14.95) | 190 | Matsubaraite | Sr4TiTi4Si4O22 |
| 5.420(16.34) | 200 | 5.072(17.47) | 184 | 6.808(12.99) | 114 | Fluoro-ferroleakeite | NaNa2(Fe++2Fe+++2Li)Si8O22F2 |
| 5.424(16.33) | 200 | 6.070(14.58) | 160 | 4.950(17.90) | 120 | Schorlomite | Ca3(Ti,Fe+++,Al)2[(Si,Fe+++,Fe++)O4]3 |
| 5.424(16.33) | 200 | 4.698(18.87) | 176 | 3.322(26.81) | 86 | Monteponite | CdO |
| 5.424(16.33) | 200 | 6.046(14.64) | 180 | 4.954(17.89) | 160 | Krutaite | CuSe2 |
| 5.424(16.33) | 200 | 5.180(17.10) | 180 | 13.880(6.36) | 80 | Uytenbogaardtite | Ag3AuS2 |
| 5.426(16.32) | 200 | 6.226(14.21) | 160 | 16.790(5.26) | 124 | Parvo-manganotremolite | [ ](CaMn)2Mg5(Si7Al)O22(OH)2 |
| 5.426(16.32) | 200 | 3.398(26.20) | 170 | 4.955(17.89) | 160 | Karelianite | V2O3 |
| 5.428(16.32) | 200 | 13.540(6.52) | 160 | 5.348(16.56) | 150 | Balangeroite | (Mg,Fe+++,Fe++,Mn++)42Si16O54(OH)40 |
| 5.428(16.32) | 200 | 16.720(5.28) | 152 | 6.200(14.27) | 132 | Parvowinchite | Na(NaMn++)(Mg4Fe+++)Si8O22(OH)2 |
| 5.428(16.32) | 200 | 16.800(5.26) | 160 | 5.124(17.29) | 140 | Potassic-chloropargasite | (K,Na)Ca2(Mg,Fe2+)4Al(Si6Al2O22)(Cl,OH)2 |
| 5.428(16.32) | 200 | 7.220(12.25) | 180 | 10.860(8.13) | 160 | Clinobehoite | Be(OH)2 |
| 5.428(16.32) | 200 | 6.240(14.18) | 180 | 5.004(17.71) | 160 | Glaucophane | [ ]Na2(Mg3Al2)Si8O22(OH)2 |
| 5.428(16.32) | 200 | 5.764(15.36) | 188 | 9.100(9.71) | 126 | Pyrocoproite | (Mg(K,Na))2P2O7 |
| 5.430(16.31) | 200 | 7.020(12.60) | 160 | 3.680(24.16) | 100 | Retzian-(La) | (Mn,Mg)2(La,Ce,Nd)(AsO4)(OH)4 |
| 5.430(16.31) | 200 | 3.718(23.91) | 100 | 3.966(22.40) | 100 | Sudovikovite | PtSe2 |
| 5.430(16.31) | 200 | 4.596(19.30) | 72 | 3.366(26.46) | 48 | Indium | In |
| 5.430(16.31) | 200 | 6.360(13.91) | 100 | 4.320(20.54) | 90 | Polyakovite-(Ce) | (Ce,La,Nd,Pr,Ca)4(Mg,Fe++)(Cr,Fe+++)2(Ti,Nb)2Si4O22 |
| 5.430(16.31) | 200 | 5.460(16.22) | 100 | 6.988(12.66) | 94 | IMA2008-064 | Na16Mn++25Al8(PO4)30 |
| 5.434(16.30) | 200 | 5.514(16.06) | 200 | 8.080(10.94) | 160 | Soucekite | PbCuBi(S,Se)3 |
| 5.434(16.30) | 200 | 7.106(12.45) | 160 | 3.696(24.06) | 100 | Retzian-(Ce) | Mn2Ce(AsO4)(OH)4 |
| 5.434(16.30) | 200 | 5.622(15.75) | 160 | 4.522(19.62) | 70 | Carbonate-hydroxylapatite | Ca5(PO4,CO3)3(OH) |
| 5.436(16.29) | 200 | 4.994(17.75) | 180 | 7.060(12.53) | 180 | Bideauxite | Pb2AgCl3(F,OH)2 |
| 5.436(16.29) | 200 | 5.696(15.54) | 180 | 5.750(15.40) | 170 | Manganilvaite | CaFe++Fe+++(Mn,Fe++)(Si2O7)O(OH) |
| 5.436(16.29) | 200 | 3.792(23.44) | 100 | 3.910(22.72) | 100 | Verbeekite | PdSe2 |
| 5.438(16.29) | 200 | 8.220(10.75) | 200 | 3.634(24.48) | 160 | Gmelinite-K | (K,Na,Ca)6(Al7Si17O48)·22(H2O) |
| 5.440(16.28) | 200 | 5.200(17.04) | 160 | 7.440(11.89) | 140 | Natrophilite | NaMnPO4 |
| 5.440(16.28) | 200 | 7.580(11.66) | 180 | 3.820(23.27) | 160 | Buchwaldite | NaCaPO4 |
| 5.440(16.28) | 200 | 16.560(5.33) | 180 | 18.000(4.91) | 180 | Manganocummingtonite | Na(Na,Mn)2(Mg4,Fe+++)5Si8O22(OH)2 |
| 5.440(16.28) | 200 | 3.312(26.90) | 140 | 4.280(20.74) | 100 | Braunite-II | Mn++Mn+++6SiO12 |
| 5.440(16.28) | 200 | 5.560(15.93) | 200 | 6.120(14.46) | 160 | Tundrite-(Ce) | Na2Ce2TiO2(SiO4)(CO3)2 |
| 5.440(16.28) | 200 | 16.840(5.24) | 200 | 6.180(14.32) | 160 | Riebeckite | [ ]Na2(Fe++3Fe+++2)Si8O22(OH)2 |
| 5.440(16.28) | 200 | 6.078(14.56) | 144 | 3.252(27.40) | 112 | Morimotoite | Ca3TiFe++Si3O12 |
| 5.440(16.28) | 200 | 16.960(5.21) | 162 | 5.220(16.97) | 118 | Potassic-ferropargasite | KCa2(Fe++4Al)Si6Al2O22(OH)2 |
| 5.440(16.28) | 200 | 3.314(26.88) | 180 | 2.842(31.45) | 160 | Bixbyite | (Mn+++,Fe+++)2O3 |
| 5.440(16.28) | 200 | 3.312(26.90) | 140 | 4.280(20.74) | 100 | Braunite-I | Mn++Mn+++6SiO12 |
| 5.440(16.28) | 200 | 7.700(11.48) | 160 | 3.498(25.44) | 140 | Seligmannite | PbCuAsS3 |
| 5.440(16.28) | 200 | 17.800(4.96) | 200 | 6.580(13.45) | 180 | Kolfanite | Ca2Fe+++3O2(AsO4)3·2(H2O) |
| 5.440(16.28) | 200 | 6.360(13.91) | 160 | 8.960(9.86) | 140 | Rankinite | Ca3Si2O7 |
| 5.440(16.28) | 200 | 3.654(24.34) | 180 | 4.900(18.09) | 160 | Glaucodot | (Co,Fe)AsS |