| |
 |
Zoisite Mineral Data
|
|
|
General Zoisite Information
|
 Chemical Formula: |
Ca2Al3(SiO4)3(OH) = Ca2AlAl2(SiO4)(Si2O7)O(OH) |
| Composition: |
Molecular Weight = 454.36 gm |
| |
Calcium 17.64 % Ca 24.68 % CaO |
| |
Aluminum 17.82 % Al 33.66 % Al2O3 |
| |
Silicon 18.54 % Si 39.67 % SiO2 |
| |
Hydrogen 0.22 % H 1.98 % H2O |
| |
Oxygen 45.78 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Ca2Al3Si3O12(OH) |
| Environment: |
Metamorphic and pegmatite rocks. |
| IMA Status: |
Valid Species (Pre-IMA) 1805 |
| Locality: |
Rauris and Saualpe, Austria. Link to MinDat.org Location Data. |
| Name Origin: |
Named after the Austrian natural scientist, Siegmund Zois (1747-1819). |
| Name Pronunciation: |
Zoisite  |
| Synonym: |
Anyolite - green |
| |
ICSD 66924 |
| |
PDF 13-562 |
| |
Tanzanite - blue |
| |
Thulite - red |
| |