| |
 |
Weilerite Mineral Data
|
|
|
General Weilerite Information
|
 Chemical Formula: |
BaAl3H[(As,P)O4]2(OH)6 |
| Composition: |
Molecular Weight = 577.19 gm |
| |
Barium 23.79 % Ba 26.56 % BaO |
| |
Aluminum 14.02 % Al 26.50 % Al2O3 |
| |
Arsenic 19.47 % As 29.87 % As2O5 |
| |
Phosphorus 2.68 % P 6.15 % P2O5 |
| |
Hydrogen 1.22 % H 10.92 % H2O |
| |
Oxygen 38.81 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
BaAl3H(AsO4)1.5(PO4)0.5(OH)6 |
| Environment: |
Redefined in 1987. |
| IMA Status: |
Approved IMA 1961 |
| Locality: |
Weiler and Neubulach, Black Forest, Germany. Link to MinDat.org Location Data. |
| Name Origin: |
Named for the locality. |
| |
Weilerite Crystallography
|
| Axial Ratios: |
a:c = 1:2.44444 |
| Cell Dimensions: |
a = 7.11, c = 17.38, Z = 3; V = 760.89 Den(Calc)= 3.78 |
| Crystal System: |
Trigonal - Hexagonal Scalenohedral H-M Symbol (3 2/m) Space Group: R 3m |
| X Ray Diffraction: |
By Intensity(I/Io): 3.01(1), 5.8(0.8), 3.54(0.7), |
| |
Physical Properties of Weilerite
|
| Color: |
White. |
| Diaphaneity: |
Transparent to Translucent |
| Hardness: |
5 - Apatite |
| Luster: |
Vitreous (Glassy) |
| |
Optical Properties of Weilerite
|
| Gladstone-Dale: |
CI calc= 0.012 (Superior) - where the CI = (1-KPDcalc/KC)
KPDcalc= 0.1833,KC= 0.1856
Ncalc = 1.7 |
| Optical Data: |
Uniaxial (-), e=1.688, w=1.698, bire=0.0100. |
| |
Calculated Properties of Weilerite
|
| Electron Density: |
Bulk Density (Electron Density)=3.55 gm/cc
note: Specific Gravity of Weilerite =3.78 gm/cc.
|
| Fermion Index: |
Fermion Index = 0.04
Boson Index = 0.96 |
| Photoelectric: |
PEWeilerite = 115.58 barns/electron
U=PEWeilerite x rElectron Density= 410.27 barns/cc.
|
| Radioactivity: |
GRapi = 0 (Gamma Ray American Petroleum Institute Units)
Weilerite is Not Radioactive |
| |
Weilerite Classification
|
| Dana Class: |
43.04.01.09 (43)Compound Phosphates, etc. |
| |
(43.04)(Anhydrous Compound Anions With Hydroxyl or Halogen) |
| |
(43.04.01)Beudantite Group |
| |
43.04.01.01 Beudantite PbFe3(AsO4)(SO4)(OH)6 R 3m 3 2/m |
| |
43.04.01.02 Corkite PbFe3(PO4)(SO4)(OH)6 R 3m 3m |
| |
43.04.01.03 Hidalgoite PbAl3(AsO4)(SO4)(OH)6 R 3m 3 2/m |
| |
43.04.01.04 Orpheite PbAl3(PO4,SO4)2(OH)6(?) R 3m 3 2/m |
| |
43.04.01.05 Hinsdalite (Pb,Sr)Al3(PO4)(SO4)(OH)6 R 3m 3 2/m |
| |
43.04.01.06 Svanbergite SrAl3(PO4)(SO4)(OH)6 R 3m 3 2/m |
| |
43.04.01.07 Kemmlitzite (Sr,Ce)Al3(AsO4)(SO4)(OH)6 R 3m 3 2/m |
| |
43.04.01.08 Woodhouseite CaAl3(PO4)(SO4)(OH)6 R 3m 3 2/m |
| |
43.04.01.09 Weilerite BaAl3H[(As,P)O4]2(OH)6 R 3m 3 2/m |
| |
43.04.01.10 Gallobeudantite! PbGa3[(AsO4),(SO4)]2(OH)6 R 3m 3m |
| Strunz Class: |
08.BL.05 08 - PHOSPHATES, ARSENATES, VANADATES |
| |
08.B - Phosphates, etc. with Additional Anions, without H2O |
| |
08.BL -With medium-sized and large cations, (OH, etc.):RO4 = 3:1 |
| |
08.BL.05 Beudantite PbFe3(AsO4)(SO4)(OH)6 R 3m 3 2/m |
| |
08.BL.05 Corkite PbFe3(PO4)(SO4)(OH)6 R 3m 3m |
| |
08.BL.05 Hidalgoite PbAl3(AsO4)(SO4)(OH)6 R 3m 3 2/m |
| |
08.BL.05 Gallobeudantite! PbGa3[(AsO4),(SO4)]2(OH)6 R 3m 3m |
| |
08.BL.05 Hinsdalite (Pb,Sr)Al3(PO4)(SO4)(OH)6 R 3m 3 2/m |
| |
08.BL.05 Kemmlitzite (Sr,Ce)Al3(AsO4)(SO4)(OH)6 R 3m 3 2/m |
| |
08.BL.05 Orpheite PbAl3(PO4,SO4)2(OH)6(?) R 3m 3 2/m |
| |
08.BL.05 Woodhouseite CaAl3(PO4)(SO4)(OH)6 R 3m 3 2/m |
| |
08.BL.05 Weilerite BaAl3H[(As,P)O4]2(OH)6 R 3m 3 2/m |
| |
08.BL.05 Svanbergite SrAl3(PO4)(SO4)(OH)6 R 3m 3 2/m |
| |
Other Weilerite Information
|
| References: |
NAME( Dana8) PHYS. PROP.(Enc. of Minerals,2nd ed.,1990) OPTIC PROP.(Enc. of Minerals,2nd ed.,1990) |
| See Also: |
Links to other databases for Weilerite :
1 - Am. Min. Crystal Structure Database
2 - Athena
3 - GeoScienceWorld
4 - Google Images
5 - Google Scholar
6 - MinDAT
7 - Mineralienatlas (Deutsch)
8 - Online Mineral Museum
9 - QUT Mineral Atlas
10 - Ruff.Info
11 - WWW-MINCRYST
Search for Weilerite using:
[AOL]
[Bing]
[Dog Pile]
[GeoScienceWorld]
[HotBot]
[Ixquick]
[Lycos]
[MAMMA]
[Scirus]
[Teoma]
[WebCrawler]
[Wikipedia]
[YAHOO]
Visit our Advertisers for Weilerite :
Ask about Weilerite here :
Ask-A-Mineralogist from the Mineralogical Society of America
Mindat.org's Discussion Groups
Original Rockhounds Discussion Group
Rockhounds Discussion Group on Yahoo Groups
Mineral Discussion Forum from Fabre Minerals - also available in
Espaņol
Print or Cut-and-Paste your Weilerite Specimen Label here :
|
Weilerite
BaAl3H[(As,P)O4]2(OH)6
Dana No: 43.04.01.09 Strunz No: 08.BL.05
Locality:
Notes:
|
|
| |
| |
|
| |
Dakota Matrix
Excalibur Minerals
Exceptional Minerals
Hudson Insitute
John Betts Fine Minerals
Mc Dougall Minerals
Mineral News
Rock and Mineral Shows
Weinrich Minerals, Inc.