|
 |
Hinsdalite Mineral Data
|
|
|
General Hinsdalite Information
|
Chemical Formula: |
(Pb,Sr)Al3(PO4)(SO4)(OH)6 |
Composition: |
Molecular Weight = 551.33 gm |
|
Strontium 3.97 % Sr 4.70 % SrO |
|
Aluminum 14.68 % Al 27.74 % Al2O3 |
|
Phosphorus 5.62 % P 12.87 % P2O5 |
|
Hydrogen 1.10 % H 9.80 % H2O |
|
Lead 28.19 % Pb 30.36 % PbO |
|
Sulfur 5.82 % S 14.52 % SO3 |
|
Oxygen 40.63 % O |
|
______ ______ |
|
100.00 % 100.00 % = TOTAL OXIDE |
Empirical Formula: |
Pb0.75Sr0.25Al3(PO4)(SO4)(OH)6 |
Environment: |
Secondary mineral in the oxidized zone of polymetallic sulfide deposits. |
IMA Status: |
Valid Species (Pre-IMA) 1911 |
Locality: |
Golden Fleece mine, Hinsdale County., Colorado, USA. Link to MinDat.org Location Data. |
Name Origin: |
Named after its locality. |
Name Pronunciation: |
Hinsdalite + Pronunciation |
|