| |
 |
Schorl-(F) Mineral Data
|
|
|
General Schorl-(F) Information
|
 Chemical Formula: |
NaFe++3Al6Si6O18)(BO3)3(OH)3(F,OH) |
| Composition: |
Molecular Weight = 1,028.43 gm |
| |
Potassium 0.04 % K 0.05 % K2O |
| |
Sodium 1.74 % Na 2.35 % Na2O |
| |
Magnesium 0.05 % Mg 0.08 % MgO |
| |
Titanium 0.09 % Ti 0.16 % TiO2 |
| |
Manganese 0.69 % Mn 0.90 % MnO |
| |
Aluminum 16.84 % Al 31.82 % Al2O3 |
| |
Zinc 0.13 % Zn 0.16 % ZnO |
| |
Iron 12.38 % Fe 13.20 % FeO / 3.03 % Fe2O3 |
| |
Silicon 16.11 % Si 34.47 % SiO2 |
| |
Boron 3.15 % B 10.15 % B2O3 |
| |
Hydrogen 0.32 % H 2.84 % H2O |
| |
Oxygen 47.04 % O |
| |
Fluorine 1.40 % F 1.40 % F |
| |
- %
F -0.59 % -O=F2 |
| |
______ ______ |
| |
100.00 % 100.02 % = TOTAL OXIDE |
| Empirical Formula: |
Na0.78K0.01Fe2+1.89Al0.58Fe3+0.13Mn2+0.13Ti0.02Mg0.02Zn0.02Al5.74Fe3+0.26Si5.9
Al0.1O18(BO3)3(OH)3F0.76(OH)0.24 |
| Environment: |
Pegmatites. |
| IMA Status: |
Not Submitted IMA (Dana # Added) |
| Locality: |
Grasstein, Sachsenklemme, Trentino, South Tyrol, Italy, in pegmatites from the Permian Brixener granite. Link to MinDat.org Location Data. |
| Name Origin: |
Named as the F analog of the hydroxyl end-member schorl, in the tourmaline group. |
| Name Pronunciation: |
Schorl-(F)  |
| Synonym: |
Tourmaline |
| |
Schorl-(F) Crystallography
|
| Axial Ratios: |
a:c = 1:0.44877 |
| Cell Dimensions: |
a = 15.997, c = 7.179, Z = 3; V = 1,591.01 Den(Calc)= 3.22 |
| Crystal System: |
Trigonal - Ditrigonal Pyramidal H-M Symbol (3m) Space Group: R 3m |
| |
Physical Properties of Schorl-(F)
|
| Color: |
Pale brown, Pale grayish blue. |
| Diaphaneity: |
Translucent |
| Fracture: |
Brittle - Conchoidal - Very brittle fracture producing small, conchoidal fragments. |
| Habit: |
Acicular - Occurs as needle-like crystals. |
| Habit: |
Prismatic - Crystals Shaped like Slender Prisms (e.g. tourmaline). |
| Habit: |
Striated - Parallel lines on crystal surface or cleavage face. |
| Hardness: |
7.5 - Garnet |
| Luster: |
Vitreous (Glassy) |
| Streak: |
brown |
| |
Optical Properties of Schorl-(F)
|
| Optical Data: |
Uniaxial (-). |
| |
NCalc= 1.68 - from Gladstone-Dale relationship (KC = 0.2114) where Ncalc=Dcalc*KC+1
|
| |
Calculated Properties of Schorl-(F)
|
| Electron Density: |
Bulk Density (Electron Density)=3.17 gm/cc
note: Specific Gravity of Schorl-(F) =3.22 gm/cc.
|
| Fermion Index: |
Fermion Index = 0.01
Boson Index = 0.99 |
| Photoelectric: |
PESchorl-(F) = 5.11 barns/electron
U=PESchorl-(F) x relectron= 16.18 barns/cc.
|
| Radioactivity: |
GRapi = 0.56 (Gamma Ray American Petroleum Institute Units)
Concentration of Schorl-(F) per GRapi unit =177.97 (%)
Estimated Radioactivity from Schorl-(F)  - barely detectable
|
| |
Schorl-(F) Classification
|
| Dana Class: |
61.03e.01.10a (61)Cyclosilicate Six-Membered Rings |
| |
(61.03e)with borate groups (Sodic Tourmaline Subgroup) |
| |
(61.03e.01)Schorl Subgroup |
| |
61.03e.01.09 Dravite! NaMg3Al6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
61.03e.01.10 Schorl! NaFe3Al6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
61.03e.01.10a Schorl-(F)! NaFe3Al6Si6O18)(BO3)3(OH)3(F,OH) R 3m 3m |
| |
61.03e.01.11 Chromdravite! NaMg3(Cr,Fe)6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
61.03e.01.12 Vanadiumdravite! NaMg3V6(Si6O18)(BO3)3(OH)4 R 3m 3m |
| Strunz Class: |
09.CK.05 09 - SILICATES (Germanates) |
| |
09.C - Cyclosilicates |
| |
09.CK -[Si6O18]12- 6-membered single rings, with insular complex anions |
| |
09.CK.05 Chromdravite! NaMg3(Cr,Fe)6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
09.CK.05 Feruvite! (Ca,Na)(Fe,Mg,Ti)3(Al,Mg,Fe)6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
09.CK.05 Dravite NaMg3Al6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
09.CK.05 Buergerite! NaFe3Al6(BO3)3Si6O21F R 3m 3m |
| |
09.CK.05 Foitite! []Na<0.5(Fe,Al)3Al6Si6O18(BO3)3(OH)4 R 3m 3m |
| |
09.CK.05 Liddicoatite! Ca(Li,Al)3Al6(BO3)3Si6O18(O,OH,F)4 R 3m 3m |
| |
09.CK.05 Elbaite Na(Li,Al)3Al6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
09.CK.05 Rossmanite! []LiAl2Al6(Si6O18)(BO3)3(OH)4 R 3m 3m |
| |
09.CK.05 Olenite! NaAl3Al6(BO3)3(Si6O18)(O,OH)4 R 3m 3m |
| |
09.CK.05 Povondraite! (Na,K)(Fe,Fe)3(Fe,Mg,Al)6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
09.CK.05 Schorl NaFe3Al6(BO3)3Si6O18(OH)4 R 3m 3m |
| |
09.CK.05 Uvite (Ca,Na)(Mg,Fe)3Al5Mg(BO3)3Si6O18(OH,F)4 R 3m 3m |
| |
09.CK.05 Vanadiumdravite! NaMg3V6(Si6O18)(BO3)3(OH)4 R 3m 3m |
| |
09.CK.05 Magnesiofoitite! [](Mg2Al)Al6(Si6O18)(BO3)3(OH)4 R 3m 3m |
| |
09.CK.05 Hydroxyuvite! CaMg3(Al5Mg)(Si6O18)(BO3)3(OH)3(OH) R 3m 3m |
| |
09.CK.05 Schorl-(F)! NaFe3Al6Si6O18)(BO3)3(OH)3(F,OH) R 3m 3m |
| |
Other Schorl-(F) Information
|
| References: |
NAME( AmMin, v92:1539) PHYS. PROP.(AmMin, v92:1539) OPTIC PROP.(AmMin, v92:1539) |
| See Also: |
Links to other databases for Schorl-(F) :
1 - Am. Min. Crystal Structure Database
2 - Athena
3 - GeoScienceWorld
4 - Google Images
5 - Google Scholar
6 - MinDAT
7 - Mineralienatlas (Deutsch)
8 - Online Mineral Museum
9 - QUT Mineral Atlas
10 - Ruff.Info
Search for Schorl-(F) using:
[AOL]
[Bing]
[Dog Pile]
[GeoScienceWorld]
[HotBot]
[Ixquick]
[Lycos]
[MAMMA]
[Scirus]
[Teoma]
[WebCrawler]
[Wikipedia]
[YAHOO]
Visit our Advertisers for Schorl-(F) :
Ask about Schorl-(F) here :
Ask-A-Mineralogist from the Mineralogical Society of America
Mindat.org's Discussion Groups
Original Rockhounds Discussion Group
Rockhounds Discussion Group on Yahoo Groups
Mineral Discussion Forum from Fabre Minerals - also available in
Espaņol
Print or Cut-and-Paste your Schorl-(F) Specimen Label here :
|
Schorl-(F)
NaFe++3Al6Si6O18)(BO3)3(OH)3(F,OH)
Dana No: 61.03e.01.10a Strunz No: 09.CK.05
Locality:
Notes:
|
|
| |
| |
|
| |
Dakota Matrix
Excalibur Minerals
Exceptional Minerals
Hudson Insitute
John Betts Fine Minerals
Mc Dougall Minerals
Mineral News
Rock and Mineral Shows
Weinrich Minerals, Inc.