X-Ray Diffraction Table |
See Help on X-Ray Diffraction.
Powder X-ray Diffraction (XRD) is one of the primary techniques used by mineralogists and solid state chemists to examine the physico-chemical make-up of unknown materials. This data is represented in a collection of single-phase X-ray powder diffraction patterns for the three most intense D values in the form of tables of interplanar spacings (D), relative intensities (I/Io), mineral name and chemical formulae
The XRD technique takes a sample of the material and places a powdered sample in a holder, then the sample is illuminated with x-rays of a fixed wave-length and the intensity of the reflected radiation is recorded using a goniometer. This data is then analyzed for the reflection angle to calculate the inter-atomic spacing (D value in Angstrom units - 10-8 cm). The intensity(I) is measured to discriminate (using I ratios) the various D spacings and the results are compared to this table to identify possible matches. Note: 2 theta (Θ) angle calculated from the Bragg Equation, 2 Θ = 2(arcsin(n λ/(2d)) where n=1
For more information about this technique, see X-Ray Analysis of a Solid or take an internet course at Birkbeck College On-line Courses. Many thanks to Frederic Biret for these data.
[ 1 ]
D1 Å (2θ) |
I1 %) |
D2 Å (2θ) |
I2 (%) |
D3 Å (2θ) |
I3 (%) |
Mineral | Formula |
8.080(10.94) | 200 | 5.140(17.24) | 160 | 6.660(13.28) | 160 | Vrbaite | Tl4Hg3Sb2As8S20 |
8.100(10.91) | 200 | 4.970(17.83) | 40 | 5.682(15.58) | 26 | Cristobalite | SiO2 |
8.108(10.90) | 200 | 18.200(4.85) | 200 | 6.056(14.61) | 160 | Barrerite | (Na,K,Ca)2Al2Si7O18·6(H2O) |
8.120(10.89) | 200 | 3.628(24.52) | 120 | 3.314(26.88) | 80 | Burtite | CaSn(OH)6 |
8.120(10.89) | 200 | 4.640(19.11) | 130 | 5.100(17.37) | 120 | Ramsdellite | MnO2 |
8.140(10.86) | 200 | 5.324(16.64) | 120 | 6.990(12.65) | 100 | Diomignite | Li2B4O7 |
8.152(10.84) | 200 | 5.612(15.78) | 136 | 6.106(14.49) | 134 | Parascorodite | Fe+++AsO4·2(H2O) |
8.158(10.84) | 200 | 16.300(5.42) | 180 | 5.580(15.87) | 170 | Kinichilite | Mg0.5[Mn++Fe+++(TeO3)3]·4.5(H2O) |
8.160(10.83) | 200 | 5.020(17.65) | 180 | 3.640(24.43) | 160 | Gutsevichite | Al3(PO4)2(OH)3·8(H2O) |
8.160(10.83) | 200 | 11.860(7.45) | 142 | 13.360(6.61) | 142 | Legrandite | Zn2(AsO4)(OH)·(H2O) |
8.160(10.83) | 200 | 9.440(9.36) | 160 | 12.980(6.80) | 160 | Rosslerite | Mg(AsO3OH)·7(H2O) |
8.180(10.81) | 200 | 5.300(16.71) | 160 | 5.092(17.40) | 140 | Bracewellite | Cr+++O(OH) |
8.200(10.78) | 200 | 5.630(15.73) | 160 | 16.380(5.39) | 130 | Levyne-Ca | (Ca,Na2,K2)Al2Si4O12·6(H2O) |
8.200(10.78) | 200 | 4.654(19.05) | 142 | 6.200(14.27) | 142 | Behierite | (Ta,Nb)BO4 |
8.200(10.78) | 200 | 25.800(3.42) | 180 | 5.920(14.95) | 160 | Gmelinite-Ca | (Ca,Na2)Al2Si4O12·6(H2O) |
8.200(10.78) | 200 | 25.800(3.42) | 180 | 5.920(14.95) | 160 | Gmelinite-Na | (Na2,Ca)Al2Si4O12·6(H2O) |
8.200(10.78) | 200 | 5.630(15.73) | 160 | 16.380(5.39) | 130 | Levyne-Na | (Na2,Ca,K2)Al2Si4O12·6(H2O) |
8.200(10.78) | 200 | 7.468(11.84) | 180 | 9.630(9.18) | 160 | Deloryite | Cu++4(UO2)(MoO4)2(OH)6 |
8.200(10.78) | 200 | 5.300(16.71) | 150 | 5.760(15.37) | 100 | Bischofite | MgCl2·6(H2O) |
8.214(10.76) | 200 | 8.656(10.21) | 180 | 7.636(11.58) | 100 | Tridymite | SiO2 |
8.218(10.76) | 200 | 5.810(15.24) | 180 | 14.282(6.18) | 160 | Brannockite | KSn2Li3Si12O30 |
8.218(10.76) | 200 | 8.434(10.48) | 174 | 11.674(7.57) | 132 | Quenstedtite | Fe+++2(SO4)3·10(H2O) |
8.220(10.75) | 200 | 8.640(10.23) | 200 | 9.660(9.15) | 200 | Kalinite | KAl(SO4)2·11(H2O) |
8.230(10.74) | 200 | 6.220(14.23) | 168 | 4.656(19.05) | 98 | Schiavinatoite | (Nb,Ta)BO4 |
8.256(10.71) | 200 | 3.867(22.98) | 108 | 5.338(16.59) | 102 | Suredaite | PbSnS3 |
8.260(10.70) | 200 | 6.400(13.83) | 100 | 6.300(14.05) | 80 | Umohoite | [(UO2)MoO4]·H2O |
8.262(10.70) | 200 | 10.990(8.04) | 150 | 5.340(16.59) | 90 | Ottemannite | Sn2S3 |
8.274(10.68) | 200 | 24.400(3.62) | 72 | 11.284(7.83) | 58 | Hematolite | (Mn,Mg,Al)15(AsO3)(AsO4)2(OH)23 |
8.280(10.68) | 200 | 6.680(13.24) | 192 | 13.380(6.60) | 122 | Ekanite | ThCa2Si8O20 |
8.288(10.67) | 200 | 5.834(15.17) | 180 | 4.826(18.37) | 160 | Laflammeite | Pd3Pb2S2 |
8.298(10.65) | 200 | 5.914(14.97) | 180 | 7.188(12.30) | 160 | Baumhauerite | Pb3As4S9 |
8.300(10.65) | 200 | 5.400(16.40) | 140 | 7.560(11.70) | 140 | Orthochevkinite | (Ce,La,Ca,Na,Th)4(Fe++,Mg)2(Ti,Fe+++)3Si4O22 |
8.304(10.64) | 200 | 7.746(11.41) | 140 | 21.994(4.01) | 100 | IMA2009-031 | NaAl6(SO4)6(SO3F)F6·36H2O |
8.306(10.64) | 200 | 7.518(11.76) | 160 | 4.238(20.94) | 140 | Nickelboussingaultite | (NH4)2(Ni,Mg)(SO4)2·6(H2O) |
8.326(10.62) | 200 | 6.358(13.92) | 198 | 7.342(12.04) | 154 | Sreinite | Pb2(UO2)11(BiO)8(PO4)5(OH)19·6(H2O) |
8.360(10.57) | 200 | 4.700(18.87) | 180 | 2.868(31.16) | 100 | Auroantimonate | AuSbO3 |
8.360(10.57) | 200 | 5.380(16.46) | 60 | 4.904(18.07) | 50 | Goethite | Fe+++O(OH) |
8.360(10.57) | 200 | 7.480(11.82) | 180 | 4.500(19.71) | 160 | Evenkite | (CH3)2(CH2)22 |
8.370(10.56) | 200 | 6.392(13.84) | 160 | 9.040(9.78) | 140 | Asselbornite | (Pb,Ba)(UO2)6(BiO)4(AsO4)2(OH)12·3(H2O) |
8.374(10.56) | 200 | 25.020(3.53) | 140 | 12.550(7.04) | 130 | Vertumnite | Ca8Al4(Al4Si5)O12[(OH)36·10(H2O) |
8.380(10.55) | 200 | 6.354(13.93) | 180 | 6.948(12.73) | 160 | Tienshanite | BaNa2MnTiB2Si6O20 |
8.400(10.52) | 200 | 9.960(8.87) | 180 | 9.380(9.42) | 160 | Stanleyite | (V++++O)SO4·6(H2O) |
8.400(10.52) | 200 | 7.580(11.66) | 110 | 8.260(10.70) | 110 | Mohrite | (NH4)2Fe++(SO4)2·6(H2O) |
8.400(10.52) | 200 | 5.340(16.59) | 140 | 5.620(15.76) | 140 | Groutite | Mn+++O(OH) |
8.400(10.52) | 200 | 10.600(8.33) | 120 | 5.700(15.53) | 50 | Morenosite | NiSO4·7(H2O) |
8.400(10.52) | 200 | 25.380(3.48) | 200 | 5.748(15.40) | 140 | Stratlingite | Ca2Al[(OH)6AlSiO2-3(OH)4-3]·2,5(H2O) |
8.400(10.52) | 200 | 6.514(13.58) | 180 | 5.504(16.09) | 170 | Eulytite | Bi4(SiO4)3 |
8.400(10.52) | 200 | 5.020(17.65) | 180 | 5.440(16.28) | 180 | Swedenborgite | NaBe4SbO7 |
8.402(10.52) | 200 | 33.574(2.63) | 200 | 16.788(5.26) | 160 | Tlalocite | Cu10Zn6(Te++++O3)(Te++++++O4)2Cl(OH)25·27(H2O) |
[ 1 ]