General Wawayandaite Information
|
 Chemical Formula: |
Ca12Mn4B2Be18Si12O46(OH,Cl)30 [Ortho] |
| Composition: |
Molecular Weight = 2,523.08 gm |
| |
Calcium 19.06 % Ca 26.67 % CaO |
| |
Manganese 8.71 % Mn 11.25 % MnO |
| |
Beryllium 6.43 % Be 17.84 % BeO |
| |
Silicon 13.36 % Si 28.58 % SiO2 |
| |
Boron 0.86 % B 2.76 % B2O3 |
| |
Hydrogen 1.08 % H 9.64 % H2O |
| |
Chlorine 4.22 % Cl 4.22 % Cl |
| |
- %
Cl -0.95 % -O=Cl2 |
| |
Oxygen 46.29 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Ca12Mn2+4B2Be18Si12O46(OH)27Cl3 |
| Environment: |
Found in a museum specimen of willemite. |
| IMA Status: |
Approved IMA 1989 |
| Locality: |
Franklin mine, Franklin, Sussex County, New Jersey, USA. Link to MinDat.org Location Data. |
| Name Origin: |
Named from the Lenni Lenape Native American word "wawayanda," many or several winding, in allusion to the grossly curved and winding habit of its crystals. |
| Name Pronunciation: |
Wawayandaite + Pronunciation  |
| Synonym: |
IMA1988-043 |
| |
