| |
 |
Trigonite Mineral Data
|
|
|
General Trigonite Information
|
Chemical Formula: |
Pb3Mn(As+++O3)2(As+++O2OH) |
Composition: |
Molecular Weight = 1,046.31 gm |
| |
Manganese 5.25 % Mn 6.78 % MnO |
| |
Arsenic 21.48 % As 28.36 % As2O3 |
| |
Hydrogen 0.10 % H 0.86 % H2O |
| |
Lead 59.41 % Pb 64.00 % PbO |
| |
Oxygen 13.76 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
Empirical Formula: |
Pb3Mn2+(AsO3)2(AsO2OH) |
Environment: |
In a metamorphosed Fe-Mn orebody. |
IMA Status: |
Valid Species (Pre-IMA) 1920 |
Locality: |
Langban, Varmland, Sweden. Link to MinDat.org Location Data. |
Name Origin: |
Named from the Greek for triangle, alluding to the characteristic crystal outline |
Name Pronunciation: |
Trigonite + Pronunciation |
Synonym: |
ICSD 100410 |
| |
PDF 23-330 |
| |