| |
 |
Thorikosite Mineral Data
|
|
|
General Thorikosite Information
|
Chemical Formula: |
Pb3(Sb+++,As+++)O3(OH)Cl2 |
Composition: |
Molecular Weight = 867.55 gm |
| |
Antimony 10.53 % Sb 12.60 % Sb2O3 |
| |
Arsenic 2.16 % As 2.85 % As2O3 |
| |
Hydrogen 0.12 % H 1.04 % H2O |
| |
Lead 71.65 % Pb 77.18 % PbO |
| |
Chlorine 8.17 % Cl 8.17 % Cl |
| |
- %
Cl -1.84 % -O=Cl2 |
| |
Oxygen 7.38 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
Empirical Formula: |
Pb3(SbO3)0.75(AsO3)0.25(OH)Cl2 |
Environment: |
Sea water altered metallugical slags. |
IMA Status: |
Approved IMA 1985 |
Locality: |
Thorikos, near the Laurium mines. Link to MinDat.org Location Data. |
Name Origin: |
Named for the locality. |
Name Pronunciation: |
Thorikosite + Pronunciation |
Synonym: |
ICSD 62160 |
| |
PDF 38-403 |
| |