| |
 |
Theisite Mineral Data
|
|
|
General Theisite Information
|
 Chemical Formula: |
Cu5Zn5[(As+++++,Sb+++++)O4]2(OH)14 |
| Composition: |
Molecular Weight = 1,184.04 gm |
| |
Zinc 27.61 % Zn 34.37 % ZnO |
| |
Copper 26.83 % Cu 33.59 % CuO |
| |
Antimony 5.14 % Sb 6.83 % Sb2O5 |
| |
Arsenic 9.49 % As 14.56 % As2O5 |
| |
Hydrogen 1.19 % H 10.65 % H2O |
| |
Oxygen 29.73 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Cu5Zn5(AsO4)1.5(SbO4)0.5(OH)14 |
| Environment: |
Found in a uranium prospect. |
| IMA Status: |
Approved IMA 1982 |
| Locality: |
Durango, La Plata, County, Colorade, USA. Link to MinDat.org Location Data. |
| Name Origin: |
Named for Nicholas J. Theis, Geologist, Bendix Corp., who discovered the orignal sample. |
| Name Pronunciation: |
Theisite  |
| |