| |
 |
Silvialite Mineral Data
|
|
|
General Silvialite Information
|
 Chemical Formula: |
(Ca,Na)4Al6Si6O24(SO4,CO3) |
| Composition: |
Molecular Weight = 939.25 gm |
| |
Sodium 2.45 % Na 3.30 % Na2O |
| |
Calcium 12.80 % Ca 17.91 % CaO |
| |
Aluminum 17.24 % Al 32.57 % Al2O3 |
| |
Silicon 17.94 % Si 38.38 % SiO2 |
| |
Carbon 0.51 % C 1.87 % CO2 |
| |
Sulfur 2.05 % S 5.11 % SO3 |
| |
Oxygen 47.01 % O |
| |
______ ______ |
| |
100.00 % 99.15 % = TOTAL OXIDE |
| Empirical Formula: |
Ca3NaAl6Si6O24(SO4)0.6(CO3)0.4 |
| Environment: |
Garnet-granulite mantle-derived xenolith in olivine nephelinite. A member of the scapolite group. |
| IMA Status: |
Approved IMA 1999 (Dana # Added) |
| Locality: |
McBride Province, North Queensland, Australia. Link to MinDat.org Location Data. |
| Name Origin: |
Named for Silvia Hillebrand, daughter of G. Tschermak, was first suggested in 1914 for the then-hypothetical SO4 analog of meionite. |
| Synonym: |
ICSD 88935 |
| |
IMA1998-010 |
| |