|
 |
Sergeevite Mineral Data
|
|
|
General Sergeevite Information
|
Chemical Formula: |
Ca2Mg11(CO3)9(HCO3)4(OH)4•6(H2O) |
Composition: |
Molecular Weight = 1,307.78 gm |
|
Calcium 6.13 % Ca 8.58 % CaO |
|
Magnesium 20.44 % Mg 33.90 % MgO |
|
Hydrogen 1.54 % H 13.78 % H2O |
|
Carbon 11.94 % C 43.75 % CO2 |
|
Oxygen 59.95 % O |
|
______ ______ |
|
100.00 % 100.00 % = TOTAL OXIDE |
Empirical Formula: |
Ca2Mg11(CO3)9(HCO3)4(OH)4•6(H2O) |
Environment: |
Weathering product of pyroxene-garnet skarn. |
IMA Status: |
Approved IMA 1980 |
Locality: |
Tyrnyauz, Caucasus, Russia. Link to MinDat.org Location Data. |
Name Origin: |
Named for Evengi M. Sergeev (1914-), engineering geologist, Moscow University. |
Name Pronunciation: |
Sergeevite + Pronunciation |
|