| |
 |
Scandiobabingtonite Mineral Data
|
|
|
General Scandiobabingtonite Information
|
 Chemical Formula: |
Ca2(Fe++,Mn)ScSi5O14(OH) |
| Composition: |
Molecular Weight = 562.16 gm |
| |
Calcium 14.26 % Ca 19.95 % CaO |
| |
Scandium 8.00 % Sc 12.27 % Sc2O3 |
| |
Manganese 2.44 % Mn 3.15 % MnO |
| |
Iron 7.45 % Fe 9.59 % FeO |
| |
Silicon 24.98 % Si 53.44 % SiO2 |
| |
Hydrogen 0.18 % H 1.60 % H2O |
| |
Oxygen 42.69 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Ca2Fe2+0.75Mn2+0.25ScSi5O14(OH) |
| Environment: |
Found in a miarolitic cavity. |
| IMA Status: |
Approved IMA 1998 (Dana # Added) |
| Locality: |
Montecatini quarry in the Baveno granite, near Novara, Piedmont, Italy. Link to MinDat.org Location Data. |
| Name Origin: |
The name reflects its composition, as the scandium analogue of babingtonite. |
| Name Pronunciation: |
Scandiobabingtonite + Pronunciation  |
| Synonym: |
ICSD 86582 |
| |
IMA1993-012 |
| |