|
 |
Montmorillonite Mineral Data
|
|
|
General Montmorillonite Information
|
Chemical Formula: |
(Na,Ca)0,3(Al,Mg)2Si4O10(OH)2•n(H2O) |
Composition: |
Molecular Weight = 549.07 gm |
|
Sodium 0.84 % Na 1.13 % Na2O |
|
Calcium 0.73 % Ca 1.02 % CaO |
|
Aluminum 9.83 % Al 18.57 % Al2O3 |
|
Silicon 20.46 % Si 43.77 % SiO2 |
|
Hydrogen 4.04 % H 36.09 % H2O |
|
Oxygen 64.11 % O |
|
______ ______ |
|
100.00 % 100.58 % = TOTAL OXIDE |
Empirical Formula: |
Na0.2Ca0.1Al2Si4O10(OH)2(H2O)10 |
IMA Status: |
Valid Species (Pre-IMA) 1847 |
Locality: |
Veinne, Montmorillone, France. Link to MinDat.org Location Data. |
Name Origin: |
Named after the locality. |
Name Pronunciation: |
Montmorillonite + Pronunciation |
Synonym: |
Bentonite |
|