|
 |
Mammothite Mineral Data
|
|
|
General Mammothite Information
|
Chemical Formula: |
Pb6Cu4AlSb+++++O2(SO4)2Cl4(OH)16 |
Composition: |
Molecular Weight = 2,284.17 gm |
|
Aluminum 1.18 % Al 2.23 % Al2O3 |
|
Copper 11.13 % Cu 13.93 % CuO |
|
Antimony 5.33 % Sb 7.08 % Sb2O5 |
|
Hydrogen 0.71 % H 6.31 % H2O |
|
Lead 54.43 % Pb 58.63 % PbO |
|
Sulfur 2.81 % S 7.01 % SO3 |
|
Chlorine 6.21 % Cl 6.21 % Cl |
|
- %
Cl -1.40 % -O=Cl2 |
|
Oxygen 18.21 % O |
|
______ ______ |
|
100.00 % 100.00 % = TOTAL OXIDE |
Empirical Formula: |
Pb6Cu4AlSbO2(SO4)2Cl4(OH)16 |
Environment: |
Secondary lead mineral. |
IMA Status: |
Approved IMA 1985 |
Locality: |
Mammoth vein, Tiger, Arizona, USA and from Laurium, Attika, Greece. Link to MinDat.org Location Data. |
Name Origin: |
Named for the locality. |
Name Pronunciation: |
Mammothite + Pronunciation |
Synonym: |
ICSD 30992 |
|
PDF 38-389 |
|