| |
 |
Mallestigite Mineral Data
|
|
|
General Mallestigite Information
|
 Chemical Formula: |
Pb3Sb+++++(SO4)(AsO4)(OH)6•3(H2O) |
| Composition: |
Molecular Weight = 1,135.63 gm |
| |
Antimony 10.18 % Sb 13.53 % Sb2O5 |
| |
Arsenic 5.81 % As 8.91 % As2O5 |
| |
Hydrogen 1.07 % H 9.53 % H2O |
| |
Lead 55.83 % Pb 60.14 % PbO |
| |
Sulfur 3.16 % S 7.90 % SO3 |
| |
Oxygen 23.95 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Pb3.06Sb0.95(SO4)1.12(AsO4)0.88(OH)5.99•3.01(H2O) |
| Environment: |
In narrow fractures of limstones formed from the weathering of galena and tetrahedrite. The antimony dominant analog of fleischerite. |
| IMA Status: |
Approved IMA 2002 (Dana # Added) |
| Locality: |
Dump of a Cu-Pp-Zn mine 1 km NW of Mallestiger Mittagskogel, Finkenstein, Villach, K�rnten, Austria Link to MinDat.org Location Data. |
| Name Origin: |
Named after the locality. |
| Synonym: |
IMA1996-043 |
| |