| |
 |
Lusungite Mineral Data
|
|
|
General Lusungite Information
|
 Chemical Formula: |
(Sr,Pb)Fe+++3(PO4)2(OH)5•(H2O) |
| Composition: |
Molecular Weight = 578.05 gm |
| |
Strontium 11.37 % Sr 13.44 % SrO |
| |
Iron 28.98 % Fe 41.44 % Fe2O3 |
| |
Phosphorus 10.72 % P 24.56 % P2O5 |
| |
Hydrogen 1.22 % H 10.91 % H2O |
| |
Lead 8.96 % Pb 10.35 % PbO2 |
| |
Oxygen 38.75 % O |
| |
______ ______ |
| |
100.00 % 100.69 % = TOTAL OXIDE |
| Empirical Formula: |
Sr0.75Pb0.25Fe3+3(PO4)2(OH)5•(H2O) |
| Environment: |
Found with iron oxyhydroxides ("limonite"). Discredited as being equal to benauite. |
| IMA Status: |
Discredited IMA 1983 - Valid Species (Pre-IMA) 1958 |
| Locality: |
Kookobo, Kivu, Zaire. Link to MinDat.org Location Data. |
| Name Origin: |
Named in 1958 for the Lusungu River, Zaire. |
| Synonym: |
Discredited IMA 1995 |
| |
Lusungite Image |
|
Images:
|
|
Lusungite Kintoreite
Comments: Greenish-yellow kintoreite crystals on limonite and or goethite. The specimen was originally labelled lusungite in the early 1990's and reinvestigation of the specimen showed it to be kintoreite.
Location: Kintore Open Cut, Broken Hill, NSW, Australia.
Scale: Specimen Size 3x6 cm.
© Diederik Visser |
|
Lusungite Crystallography
|
| Axial Ratios: |
a:c = 1:2.38636 |
| Cell Dimensions: |
a = 7.04, c = 16.8, Z = 3; V = 721.08 Den(Calc)= 3.99 |
| Crystal System: |
Trigonal - Ditrigonal Pyramidal H-M Symbol (3m) Space Group: R 3m |
| X Ray Diffraction: |
By Intensity(I/Io): 2.98(1), 5.77(0.9), 3.53(0.6),2.48(0.4), 1.913(0.2), 2.22(0.2), 2.26(0.2), 2.2(0.1), |
| |
Physical Properties of Lusungite
|
| Color: |
Dark brown, Yellowish brown. |
| Density: |
4.06 |
| Diaphaneity: |
Translucent |
| Habit: |
Encrustations - Forms crust-like aggregates on matrix. |
| Streak: |
yellowish brown |
| |
Optical Properties of Lusungite
|
| Optical Data: |
Uniaxial (?). |
| |
NCalc= 1.97 - from Gladstone-Dale relationship (KC = 0.2429) where Ncalc=Dcalc*KC+1
NCalc= 1.99 - from Gladstone-Dale relationship (KC = 0.2429) where Ncalc=Dmeas*KC+1
|
| |
Calculated Properties of Lusungite
|
| Electron Density: |
Bulk Density (Electron Density)=3.81 gm/cc
note: Specific Gravity of Lusungite =3.99 gm/cc.
|
| Fermion Index: |
Fermion Index = 0.03
Boson Index = 0.97 |
| Photoelectric: |
PELusungite = 166.03 barns/electron
U=PELusungite x rElectron Density= 632.61 barns/cc.
|
| Radioactivity: |
GRapi = 0 (Gamma Ray American Petroleum Institute Units)
Lusungite is Not Radioactive |
| |
Lusungite Classification
|
| Dana Class: |
42.07.03.04 (42)Hydrated Phosphates, etc., Containing Hydroxyl or Halogen |
| |
(42.07)where (AB)5 (XO4)3 Zq � x(H2O) |
| |
(42.07.03)Crandallite Group |
| |
42.07.03.01 Crandallite CaAl3(PO4)2(OH)5•(H2O) R 3m 3 2/m |
| |
42.07.03.02 Gorceixite BaAl3(PO4)(PO3OH)(OH)6 R 3m 3 2/m |
| |
42.07.03.03 Goyazite SrAl3(PO4)2(OH)5•(H2O) R 3m 3 2/m |
| |
42.07.03.04 Lusungite? (Sr,Pb)Fe3(PO4)2(OH)5•(H2O) R 3m 3m |
| |
42.07.03.05 Plumbogummite PbAl3(PO4)2(OH)5•(H2O) R 3m 3 2/m |
| |
42.07.03.06 Kintoreite PbFe3(PO4)2(OH,H2O)6 R 3m 3 2/m |
| |
42.07.03.07 Benauite! HSrFe3(PO4)2(OH)6 R 3m 3 2/m |
| |
42.07.03.08 Springcreekite! BaV3(PO4)2(OH,H2O)6 R 3m 3 2/m |
| Strunz Class: |
08.BL.10 08 - PHOSPHATES, ARSENATES, VANADATES |
| |
08.B - Phosphates, etc. with Additional Anions, without H2O |
| |
08.BL -With medium-sized and large cations, (OH, etc.):RO4 = 3:1 |
| |
08.BL.10 Arsenogorceixite! BaAl3AsO3(OH)(AsO4,PO4)(OH,F)6 R 3m 3 2/m |
| |
08.BL.10 Arsenocrandallite (Ca,Sr)Al3[(As,P)O4]2(OH)5•(H2O) R 3m 3m |
| |
08.BL.10 Ferrazite? (Pb,Ba)3(PO4)2•8(H2O)(?) Tri |
| |
08.BL.10 Arsenowaylandite* BiAl3(AsO4)2(OH)6 R 3m 3 2/m |
| |
08.BL.10 Benauite! HSrFe3(PO4)2(OH)6 R 3m 3 2/m |
| |
08.BL.10 Arsenogoyazite (Sr,Ca,Ba)Al3(AsO4,PO4)2(OH,F)5•(H2O) R 3m 3 2/m |
| |
08.BL.10 Dussertite BaFe3(AsO4)2(OH)5 R 3m 3m |
| |
08.BL.10 Crandallite CaAl3(PO4)2(OH)5•(H2O) R 3m 3 2/m |
| |
08.BL.10 Goyazite SrAl3(PO4)2(OH)5•(H2O) R 3m 3 2/m |
| |
08.BL.10 Gorceixite BaAl3(PO4)(PO3OH)(OH)6 R 3m 3 2/m |
| |
08.BL.10 Kintoreite PbFe3(PO4)2(OH,H2O)6 R 3m 3 2/m |
| |
08.BL.10 Lusungite? (Sr,Pb)Fe3(PO4)2(OH)5•(H2O) R 3m 3m |
| |
08.BL.10 Philipsbornite PbAl3(AsO4)2(OH)5•(H2O) R 3m-,R 3m Trig |
| |
08.BL.10 Plumbogummite PbAl3(PO4)2(OH)5•(H2O) R 3m 3 2/m |
| |
08.BL.10 Segnitite PbFe3H(AsO4)2(OH)6 R 3m 3 2/m |
| |
08.BL.10 Springcreekite! BaV3(PO4)2(OH,H2O)6 R 3m 3 2/m |
| |
Other Lusungite Information
|
| References: |
NAME( Dana8) |
| See Also: |
Links to other databases for Lusungite :
1 - Am. Min. Crystal Structure Database
2 - Athena
3 - GeoScienceWorld
4 - Google Images
5 - Google Scholar
6 - MinDAT
7 - Mineralienatlas (Deutsch)
8 - Online Mineral Museum
9 - QUT Mineral Atlas
10 - Ruff.Info
11 - WWW-MINCRYST
Search for Lusungite using:
[AOL]
[Bing]
[Dog Pile]
[GeoScienceWorld]
[HotBot]
[Ixquick]
[Lycos]
[MAMMA]
[Scirus]
[Teoma]
[WebCrawler]
[Wikipedia]
[YAHOO]
Visit our Advertisers for Lusungite :
Ask about Lusungite here :
Ask-A-Mineralogist from the Mineralogical Society of America
Mindat.org's Discussion Groups
Original Rockhounds Discussion Group
Rockhounds Discussion Group on Yahoo Groups
Mineral Discussion Forum from Fabre Minerals - also available in
Español
Print or Cut-and-Paste your Lusungite Specimen Label here :
|
Lusungite
(Sr,Pb)Fe+++3(PO4)2(OH)5•(H2O)
Dana No: 42.07.03.04 Strunz No: 08.BL.10
Locality:
Notes:
|
|
| |
| |
|
| |
Dakota Matrix
Excalibur Minerals
Exceptional Minerals
Hudson Insitute
John Betts Fine Minerals
Mc Dougall Minerals
Mineral News
Rock and Mineral Shows
Weinrich Minerals, Inc.