| |
 |
Kegelite Mineral Data
|
|
|
General Kegelite Information
|
 Chemical Formula: |
Pb8Al4Si8O20(SO4)2(CO3)4(OH)8 |
| Composition: |
Molecular Weight = 2,878.42 gm |
| |
Aluminum 3.75 % Al 7.08 % Al2O3 |
| |
Silicon 7.81 % Si 16.70 % SiO2 |
| |
Hydrogen 0.28 % H 2.50 % H2O |
| |
Lead 57.59 % Pb 62.03 % PbO |
| |
Carbon 1.67 % C 6.12 % CO2 |
| |
Sulfur 2.23 % S 5.56 % SO3 |
| |
Oxygen 26.68 % O |
| |
______ ______ |
| |
100.00 % 100.00 % = TOTAL OXIDE |
| Empirical Formula: |
Pb8Al4Si8(SO4)2(CO3)4(OH)8O20 |
| Environment: |
Deep oxidation zone at the mine. |
| IMA Status: |
Approved IMA 1975 |
| Locality: |
Tsumbe, Namibia. Link to MinDat.org Location Data. |
| Name Origin: |
Named for Friedrich Wilhelm Kegel, director of the Tsumbe mine from 1922 to 1938. |
| Name Pronunciation: |
Kegelite  |
| |