|
 |
Iranite Mineral Data
|
|
|
General Iranite Information
|
Chemical Formula: |
Pb10Cu(CrO4)6(SiO4)2(F,OH)2 |
Composition: |
Molecular Weight = 3,052.68 gm |
|
Chromium 10.22 % Cr 19.65 % CrO3 |
|
Copper 2.08 % Cu 2.34 % Cu2O |
|
Silicon 1.84 % Si 3.94 % SiO2 |
|
Hydrogen 0.02 % H 0.15 % H2O |
|
Lead 67.87 % Pb 73.12 % PbO |
|
Oxygen 17.03 % O |
|
Fluorine 0.93 % F 0.93 % F |
|
- %
F -0.39 % -O=F2 |
|
______ ______ |
|
100.00 % 99.74 % = TOTAL OXIDE |
Empirical Formula: |
Pb10Cu(CrO4)6(SiO4)2F1.5(OH)0.5 |
IMA Status: |
Approved IMA 1963 |
Locality: |
Sebarz mine, NE of Anarak, Iran. Link to MinDat.org Location Data. |
Name Origin: |
Name for the country. |
Name Pronunciation: |
Iranite |
|