| |
 |
IMA2003-019 Mineral Data
|
|
|
General IMA2003-019 Information
|
Chemical Formula: |
Na6Sr12Ba2Zr13Si39B4O123(OH)6 •20(H2O) |
Composition: |
Molecular Weight = 6,218.79 gm |
| |
Barium 4.42 % Ba 4.93 % BaO |
| |
Sodium 2.22 % Na 2.99 % Na2O |
| |
Strontium 16.91 % Sr 19.99 % SrO |
| |
Zirconium 19.07 % Zr 25.76 % ZrO2 |
| |
Silicon 17.61 % Si 37.68 % SiO2 |
| |
Boron 0.70 % B 2.24 % B2O3 |
| |
Hydrogen 0.75 % H 6.66 % H2O |
| |
Oxygen 38.33 % O |
| |
______ ______ |
| |
100.00 % 100.26 % = TOTAL OXIDE |
Empirical Formula: |
Na6Sr12Ba2Zr13Si39B4O123(OH)6•20(H2O) |
Environment: |
Related to benitoite |
IMA Status: |
Proposed IMA 2003 (Dana # Added) |
Locality: |
Link to MinDat.org Location Data. |
Name Origin: |
Commission on New Minerals, Nomenclature and Classification (CNMNC) |
| |