|
 |
Cerite-(Ce) Mineral Data
|
|
|
General Cerite-(Ce) Information
|
Chemical Formula: |
Ce+++9Fe+++(SiO4)6[(SiO3)(OH)](OH)3 |
Composition: |
Molecular Weight = 2,013.49 gm |
|
Cerium 62.63 % Ce 73.36 % Ce2O3 |
|
Iron 2.77 % Fe 3.97 % Fe2O3 |
|
Silicon 9.76 % Si 20.89 % SiO2 |
|
Hydrogen 0.20 % H 1.79 % H2O |
|
Oxygen 24.63 % O |
|
______ ______ |
|
100.00 % 100.00 % = TOTAL OXIDE |
Empirical Formula: |
Ce9Fe3+(SiO4)6(SiO3)(OH)4 |
Environment: |
Rare-earth ore deposits. |
IMA Status: |
Valid Species (Pre-IMA) 1803 |
Locality: |
Bastnaes mine near Riddarhyttan, Vastmanland, Seden. Link to MinDat.org Location Data. |
Name Origin: |
Named for the cerium content. |
Synonym: |
ICSD 31226 |
|
PDF 11-126 |
|