| |
 |
Bayldonite Mineral Data
|
|
|
General Bayldonite Information
|
 Chemical Formula: |
(Cu,Zn)3Pb(AsO3OH)2(OH)2 |
| Composition: |
Molecular Weight = 730.28 gm |
| |
Zinc 2.69 % Zn 3.34 % ZnO |
| |
Copper 23.49 % Cu 29.41 % CuO |
| |
Arsenic 20.52 % As 31.47 % As2O5 |
| |
Hydrogen 0.83 % H 7.40 % H2O |
| |
Lead 28.37 % Pb 30.56 % PbO |
| |
Oxygen 24.10 % O |
| |
______ ______ |
| |
100.00 % 102.19 % = TOTAL OXIDE |
| Empirical Formula: |
Cu2.7Zn0.3Pb(AsO3OH)2(OH)2•(H2O) |
| Environment: |
Vesignieite is the structural analog. |
| IMA Status: |
Valid Species (Pre-IMA) 1865 |
| Locality: |
St. Day, Cornwall, England Link to MinDat.org Location Data. |
| Name Origin: |
Named after John Bayldon of England. |
| Name Pronunciation: |
Bayldonite + Pronunciation  |
| Synonym: |
ICSD 8268 |
| |
PDF 26-1410 |
| |